![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[TXT]](/icons/text.gif){kind=icon}
![[ ]](/icons/script.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
![[IMG]](/icons/image2.gif){kind=icon}
![[ ]](/icons/compressed.gif){kind=icon}
![[ ]](/icons/p.gif){kind=icon}
![[ ]](/icons/tar.gif){kind=icon}
![[ ]](/icons/binary.gif){kind=icon}
![[ ]](/icons/layout.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| test.txt | 2025-04-02 19:40 | 12 | |
| check_all_disks.conf | 2025-04-02 19:39 | 38 | |
| snmpd.conf | 2025-04-02 19:39 | 54 | |
| get-dfsreport.sh | 2025-04-02 19:39 | 64 | |
| vmware.cfg | 2025-04-02 19:38 | 72 | |
| check_rmi | 2025-04-02 19:38 | 85 | |
| snmp_uptime.sh | 2025-04-02 19:39 | 88 | |
| snmp_cpuload.sh | 2025-04-02 19:39 | 118 | |
| snmp_memload.sh | 2025-04-02 19:39 | 142 | |
| command.cfg.txt | 2025-04-02 19:38 | 174 | |
| send_nagios.txt | 2025-04-02 19:39 | 183 | |
| downtime-ani.gif | 2025-04-02 19:39 | 210 | |
| thresholds.txt | 2025-04-02 19:39 | 231 | |
| snmp_diskspace.sh | 2025-04-02 19:39 | 233 | |
| checkcommands.cfg | 2025-04-02 19:40 | 243 | |
| check_process.bat.txt | 2025-04-02 19:39 | 248 | |
| check_iis-std.conf | 2025-04-02 19:38 | 263 | |
| vortex_info_trap_wra..> | 2025-04-02 19:39 | 264 | |
| submit_check_result.sh | 2025-04-02 19:39 | 265 | |
| vortex_warning_trap_..> | 2025-04-02 19:39 | 265 | |
| vortex_critical_trap..> | 2025-04-02 19:39 | 267 | |
| SQL-Structure-for_ch..> | 2025-04-02 19:38 | 268 | |
| send_log.sh | 2025-04-02 19:39 | 268 | |
| service.cfg.txt | 2025-04-02 19:38 | 291 | |
| check_ast_chan | 2025-04-02 19:38 | 302 | |
| check_cisco_voice.ncfg | 2025-04-02 19:38 | 310 | |
| check_wbinfo | 2025-04-02 19:39 | 325 | |
| ChangeLog.txt | 2025-04-02 19:39 | 333 | |
| cups-queue.sh | 2025-04-02 19:38 | 340 | |
| check_xcat | 2025-04-02 19:38 | 345 | |
| dig-ani.gif | 2025-04-02 19:39 | 346 | |
| check_http_ntlm | 2025-04-02 19:40 | 347 | |
| genicons.sh | 2025-04-02 19:39 | 363 | |
| delay-ani.gif | 2025-04-02 19:39 | 369 | |
| check_vmware-0.1 | 2025-04-02 19:39 | 376 | |
| check_tracert | 2025-04-02 19:40 | 395 | |
| check_nrpe_hwinfo.sh | 2025-04-02 19:39 | 405 | |
| errptnagios.sh | 2025-04-02 19:39 | 407 | |
| ping_remote.cmd.txt | 2025-04-02 19:39 | 411 | |
| Readme.txt | 2025-04-02 19:39 | 414 | |
| check_beacon | 2025-04-02 19:39 | 415 | |
| check_https | 2025-04-02 19:38 | 416 | |
| samplefile.txt | 2025-04-02 19:40 | 416 | |
| check_murmur | 2025-04-02 19:38 | 418 | |
| check_powerchute.tar.gz | 2025-04-02 19:38 | 459 | |
| check_postqueue | 2025-04-02 19:38 | 463 | |
| check_temperature_tm..> | 2025-04-02 19:40 | 480 | |
| check_zones.pl | 2025-04-02 19:39 | 489 | |
| check_dig.txt | 2025-04-02 19:39 | 491 | |
| check_pop3_login | 2025-04-02 19:38 | 496 | |
| check_3510_ld | 2025-04-02 19:39 | 498 | |
| 1-wiretemp.map | 2025-04-02 19:40 | 503 | |
| check_raid | 2025-04-02 19:39 | 512 | |
| check_hvdisp | 2025-04-02 19:39 | 513 | |
| readme | 2025-04-02 19:39 | 531 | |
| install | 2025-04-02 19:38 | 541 | |
| dell-openmanage.cfg | 2025-04-02 19:39 | 559 | |
| check_gmirror | 2025-04-02 19:38 | 567 | |
| check_mylex | 2025-04-02 19:39 | 575 | |
| check_diskrw | 2025-04-02 19:39 | 603 | |
| check_processor | 2025-04-02 19:39 | 613 | |
| check_snort.tgz | 2025-04-02 19:38 | 619 | |
| check_local_tapedriv..> | 2025-04-02 19:40 | 632 | |
| check_ifoperstatNAS | 2025-04-02 19:38 | 637 | |
| groupwise-api.php | 2025-04-02 19:39 | 638 | |
| VICommon.pm.patch | 2025-04-02 19:39 | 644 | |
| check_legato | 2025-04-02 19:39 | 652 | |
| check_sun_raidctl.sh | 2025-04-02 19:39 | 656 | |
| alarm_summary.zip | 2025-04-02 19:38 | 674 | |
| check_nfs_client | 2025-04-02 19:38 | 675 | |
| Check_filesize.pl | 2025-04-02 19:39 | 692 | |
| check_uptime.php | 2025-04-02 19:39 | 720 | |
| check_filesize.zip | 2025-04-02 19:39 | 724 | |
| nw2nagios.sh | 2025-04-02 19:39 | 729 | |
| check_ipmi_chassis | 2025-04-02 19:39 | 737 | |
| check_services.pl | 2025-04-02 19:39 | 754 | |
| check_linksys.spec | 2025-04-02 19:39 | 757 | |
| check_perc5i.c | 2025-04-02 19:39 | 758 | |
| check_roles.pl | 2025-04-02 19:39 | 779 | |
| check_spamc-0.1.tgz | 2025-04-02 19:38 | 784 | |
| check_ossec.tgz | 2025-04-02 19:38 | 804 | |
| check_vxdisk.pl | 2025-04-02 19:39 | 804 | |
| check_zones | 2025-04-02 19:39 | 811 | |
| check-traffic.php | 2025-04-02 19:39 | 817 | |
| servers.txt | 2025-04-02 19:39 | 823 | |
| check_mountpoints.py | 2025-04-02 19:39 | 830 | |
| check_smsfinder.cfg | 2025-04-02 19:39 | 834 | |
| check_svcs | 2025-04-02 19:39 | 840 | |
| check_messages_file.sh | 2025-04-02 19:39 | 841 | |
| check_twist | 2025-04-02 19:38 | 847 | |
| check_ifcfg.ksh | 2025-04-02 19:39 | 856 | |
| check_pbssched | 2025-04-02 19:38 | 865 | |
| check_any.php.gz | 2025-04-02 19:38 | 867 | |
| check_pbsmom | 2025-04-02 19:38 | 878 | |
| check_ipmi_sdr_ok | 2025-04-02 19:39 | 882 | |
| check_disksuite.pl | 2025-04-02 19:39 | 887 | |
| check_perc6i.sh | 2025-04-02 19:39 | 889 | |
| snmp_bond | 2025-04-02 19:39 | 891 | |
| nagiosr.txt | 2025-04-02 19:39 | 894 | |
| check_zpools | 2025-04-02 19:39 | 895 | |
| check_users_adv.ncfg | 2025-04-02 19:38 | 897 | |
| check_mq.zip | 2025-04-02 19:39 | 911 | |
| check_snalink.gz | 2025-04-02 19:39 | 934 | |
| Check_Printer.tar.gz | 2025-04-02 19:39 | 942 | |
| check_cpu.ksh | 2025-04-02 19:39 | 947 | |
| hosts.cfg | 2025-04-02 19:40 | 952 | |
| check_snmp_crc.sh | 2025-04-02 19:39 | 959 | |
| check_dxml_drvstate.zip | 2025-04-02 19:39 | 963 | |
| check_http_nagios.py | 2025-04-02 19:38 | 971 | |
| check_debian.tgz | 2025-04-02 19:38 | 1.0K | |
| comment-ani.gif | 2025-04-02 19:39 | 1.0K | |
| check_pbsserver | 2025-04-02 19:38 | 1.0K | |
| check_nproc_snmp | 2025-04-02 19:39 | 1.0K | |
| check_raidctl | 2025-04-02 19:39 | 1.0K | |
| checkcommands_HPPro.cfg | 2025-04-02 19:39 | 1.0K | |
| check_ifstatus.tar.gz | 2025-04-02 19:39 | 1.0K | |
| check_backupexec.wsf | 2025-04-02 19:39 | 1.0K | |
| check_snmp_intreset.sh | 2025-04-02 19:39 | 1.0K | |
| process-service-perf..> | 2025-04-02 19:39 | 1.0K | |
| check_aix_paging.sh | 2025-04-02 19:39 | 1.0K | |
| check_cisco_ping_ssh | 2025-04-02 19:39 | 1.0K | |
| check_rootkit.gz | 2025-04-02 19:38 | 1.0K | |
| check_tripwire.pl | 2025-04-02 19:38 | 1.0K | |
| check_nfs_mounts.rtf | 2025-04-02 19:40 | 1.0K | |
| check_snmp_cisco_tem..> | 2025-04-02 19:38 | 1.0K | |
| Check_array_5300.txt | 2025-04-02 19:39 | 1.0K | |
| Check_array_P400.txt | 2025-04-02 19:39 | 1.0K | |
| check_usthreat-0.02 | 2025-04-02 19:38 | 1.1K | |
| Check_array_ccis.txt | 2025-04-02 19:39 | 1.1K | |
| check_smb | 2025-04-02 19:38 | 1.1K | |
| check_snmp_cisco_ios..> | 2025-04-02 19:38 | 1.1K | |
| check_smf | 2025-04-02 19:39 | 1.1K | |
| check_aix_hdisk.sh | 2025-04-02 19:39 | 1.1K | |
| check_top_process.sh | 2025-04-02 19:38 | 1.1K | |
| check_gwiarl.sh | 2025-04-02 19:39 | 1.1K | |
| sendEvent2Nagios.sh | 2025-04-02 19:39 | 1.1K | |
| check_dxml_drvstate_..> | 2025-04-02 19:39 | 1.1K | |
| check_altiris | 2025-04-02 19:39 | 1.2K | |
| utils.php | 2025-04-02 19:39 | 1.2K | |
| check_errpt | 2025-04-02 19:39 | 1.2K | |
| check_aix_cpu.sh | 2025-04-02 19:39 | 1.2K | |
| check_Nbusers | 2025-04-02 19:38 | 1.2K | |
| check_upsparam.tar.gz | 2025-04-02 19:40 | 1.2K | |
| VORTEX-TRAP-template..> | 2025-04-02 19:39 | 1.2K | |
| nrvoice11.cfg | 2025-04-02 19:38 | 1.2K | |
| check_VCS_0.9.tar.gz | 2025-04-02 19:39 | 1.2K | |
| install.txt | 2025-04-02 19:39 | 1.2K | |
| check_aix_cpu.pl | 2025-04-02 19:39 | 1.2K | |
| check_ups_nut | 2025-04-02 19:39 | 1.2K | |
| readme_dig.txt | 2025-04-02 19:39 | 1.2K | |
| nagios_check_google_..> | 2025-04-02 19:38 | 1.2K | |
| check_bmc_dell_raid | 2025-04-02 19:39 | 1.2K | |
| Check_Printer-0.2.ta..> | 2025-04-02 19:39 | 1.2K | |
| syslog-ng.conf.txt | 2025-04-02 19:39 | 1.2K | |
| check_win_snmp_cpulo..> | 2025-04-02 19:39 | 1.3K | |
| check_samsung_cartri..> | 2025-04-02 19:39 | 1.3K | |
| check_bmc_intrusion | 2025-04-02 19:39 | 1.3K | |
| check_win_snmp_cpu.pl | 2025-04-02 19:39 | 1.3K | |
| check_snmp_cisco_mem..> | 2025-04-02 19:38 | 1.3K | |
| check_local_mem.pl | 2025-04-02 19:39 | 1.3K | |
| check_imap_mailbox.gz | 2025-04-02 19:38 | 1.3K | |
| check_proc_by_snmp.sh | 2025-04-02 19:38 | 1.3K | |
| check_disk | 2025-04-02 19:39 | 1.3K | |
| check_services.zip | 2025-04-02 19:39 | 1.3K | |
| Check_Printer-v_0.3...> | 2025-04-02 19:39 | 1.3K | |
| handle_SCOM_mail.pl | 2025-04-02 19:39 | 1.3K | |
| sqlsnmp.reg.txt | 2025-04-02 19:39 | 1.3K | |
| bigip_service.pl | 2025-04-02 19:39 | 1.3K | |
| check_dnscluster.pl | 2025-04-02 19:38 | 1.3K | |
| check_hpraid.pl | 2025-04-02 19:39 | 1.3K | |
| amavis_check.pl | 2025-04-02 19:38 | 1.3K | |
| check_shorewall | 2025-04-02 19:38 | 1.3K | |
| check_usthreat | 2025-04-02 19:38 | 1.3K | |
| check_cups_jobs.gz | 2025-04-02 19:39 | 1.4K | |
| Check_Printer-0.4.ta..> | 2025-04-02 19:39 | 1.4K | |
| check_win_cpuload | 2025-04-02 19:39 | 1.4K | |
| vmware-host.nagios | 2025-04-02 19:39 | 1.4K | |
| check_conntrack.sh | 2025-04-02 19:38 | 1.4K | |
| check_3ware | 2025-04-02 19:39 | 1.4K | |
| check_process_by_ssh | 2025-04-02 19:38 | 1.4K | |
| check_snmp_cdp-neigh..> | 2025-04-02 19:40 | 1.4K | |
| srcd_redhat | 2025-04-02 19:39 | 1.4K | |
| check_ntp_dummy | 2025-04-02 19:39 | 1.4K | |
| check_log_growth-0.3..> | 2025-04-02 19:38 | 1.4K | |
| check_tape_drives.sh | 2025-04-02 19:38 | 1.4K | |
| check_uk_terror.pl | 2025-04-02 19:38 | 1.4K | |
| check_backuppc.tar.gz | 2025-04-02 19:38 | 1.4K | |
| notifications.README | 2025-04-02 19:39 | 1.5K | |
| check_amanda.pl | 2025-04-02 19:38 | 1.5K | |
| check_fs_space | 2025-04-02 19:39 | 1.5K | |
| check_laptop_battery..> | 2025-04-02 19:39 | 1.5K | |
| check_mount.sh | 2025-04-02 19:39 | 1.5K | |
| check_ipsecctl.txt | 2025-04-02 19:39 | 1.5K | |
| deep-ssh.txt | 2025-04-02 19:38 | 1.5K | |
| check_dummy-1.1.zip | 2025-04-02 19:39 | 1.5K | |
| INSTALL.txt | 2025-04-02 19:38 | 1.5K | |
| check_bmc_voltage | 2025-04-02 19:39 | 1.5K | |
| check_esx_load.php | 2025-04-02 19:38 | 1.5K | |
| check_imap_login.txt | 2025-04-02 19:38 | 1.5K | |
| check_toner | 2025-04-02 19:39 | 1.5K | |
| check_openvault | 2025-04-02 19:39 | 1.5K | |
| check_snmp_cisco_lin..> | 2025-04-02 19:38 | 1.5K | |
| be_the_one.pl | 2025-04-02 19:39 | 1.5K | |
| bigip_interface.pl | 2025-04-02 19:39 | 1.6K | |
| check_fax.sh.gz | 2025-04-02 19:39 | 1.6K | |
| check_snmp_hpux_mem | 2025-04-02 19:39 | 1.6K | |
| check_z3950 | 2025-04-02 19:39 | 1.6K | |
| check_url.pl | 2025-04-02 19:38 | 1.6K | |
| check_nfs_stale.txt | 2025-04-02 19:38 | 1.6K | |
| check_lpq.php | 2025-04-02 19:39 | 1.6K | |
| check_esx_date.php | 2025-04-02 19:38 | 1.6K | |
| check_traffic_ipfwco..> | 2025-04-02 19:38 | 1.6K | |
| count_file.pl | 2025-04-02 19:38 | 1.6K | |
| check_esx_redo2.php | 2025-04-02 19:38 | 1.6K | |
| check_mounts | 2025-04-02 19:38 | 1.6K | |
| check_Arcserve_jobst..> | 2025-04-02 19:38 | 1.6K | |
| check_dp_mediapool_s..> | 2025-04-02 19:39 | 1.6K | |
| check_pop3_limit2.pl | 2025-04-02 19:38 | 1.6K | |
| check_kolab2 | 2025-04-02 19:39 | 1.6K | |
| check_vos.sh | 2025-04-02 19:39 | 1.6K | |
| SymanticChk.vbs.txt | 2025-04-02 19:39 | 1.6K | |
| check_multipath.tar.gz | 2025-04-02 19:39 | 1.6K | |
| check_errpt.pl | 2025-04-02 19:39 | 1.7K | |
| check_win_snmp_disk_..> | 2025-04-02 19:38 | 1.7K | |
| test_check_suncluste..> | 2025-04-02 19:39 | 1.7K | |
| check_snmp_disk.tar.gz | 2025-04-02 19:40 | 1.7K | |
| check_dir_filecount.sh | 2025-04-02 19:39 | 1.7K | |
| check_cups_printer.t..> | 2025-04-02 19:39 | 1.7K | |
| service_status.awk | 2025-04-02 19:39 | 1.7K | |
| groupwise-handlerthr..> | 2025-04-02 19:39 | 1.7K | |
| check_diskwrite.sh | 2025-04-02 19:39 | 1.7K | |
| host_status.awk | 2025-04-02 19:39 | 1.7K | |
| check_nbu_drive_path..> | 2025-04-02 19:38 | 1.7K | |
| check_cpu | 2025-04-02 19:39 | 1.7K | |
| check_nb_queue-0.1.pl | 2025-04-02 19:38 | 1.7K | |
| check_nagios_latency.sh | 2025-04-02 19:39 | 1.7K | |
| check_cpanel.py | 2025-04-02 19:39 | 1.7K | |
| check_ping.pl | 2025-04-02 19:38 | 1.7K | |
| uptime.sh | 2025-04-02 19:38 | 1.7K | |
| uptime.sh-rev.02 | 2025-04-02 19:38 | 1.7K | |
| patch-statusmap-nagi..> | 2025-04-02 19:38 | 1.7K | |
| check_esx_redo.php | 2025-04-02 19:38 | 1.7K | |
| test_log2.txt | 2025-04-02 19:39 | 1.8K | |
| check_nis_1.0 | 2025-04-02 19:38 | 1.8K | |
| check_bmc_fan_status | 2025-04-02 19:39 | 1.8K | |
| Weblogic_Queue.sh | 2025-04-02 19:39 | 1.8K | |
| check_cisco_modules.sh | 2025-04-02 19:39 | 1.8K | |
| check_mem.sh | 2025-04-02 19:38 | 1.8K | |
| check_3ware.tar.bz2 | 2025-04-02 19:39 | 1.8K | |
| check_bacula.sh | 2025-04-02 19:38 | 1.8K | |
| check_fetchmail.sh | 2025-04-02 19:39 | 1.8K | |
| check_noaxfr | 2025-04-02 19:38 | 1.8K | |
| check_amavis.pl | 2025-04-02 19:38 | 1.8K | |
| check_pdu | 2025-04-02 19:39 | 1.8K | |
| check_vserver | 2025-04-02 19:38 | 1.8K | |
| check_snmp_apc_pdu.gz | 2025-04-02 19:38 | 1.8K | |
| check_openvpn.php | 2025-04-02 19:40 | 1.8K | |
| check_dxml_drvstate_..> | 2025-04-02 19:39 | 1.8K | |
| smart_send_nsca.cfg | 2025-04-02 19:39 | 1.8K | |
| check_win_process | 2025-04-02 19:39 | 1.8K | |
| check_vdisk.sh | 2025-04-02 19:38 | 1.8K | |
| check_slipstream.sh | 2025-04-02 19:39 | 1.8K | |
| check_ram-1.1.zip | 2025-04-02 19:39 | 1.8K | |
| check_mailman_qfiles | 2025-04-02 19:38 | 1.8K | |
| check_storeBackup | 2025-04-02 19:38 | 1.8K | |
| check_systime-104b.zip | 2025-04-02 19:38 | 1.8K | |
| check_ipmi_sensors | 2025-04-02 19:39 | 1.8K | |
| check_gdth | 2025-04-02 19:39 | 1.9K | |
| check_ldap_bind.txt | 2025-04-02 19:38 | 1.9K | |
| uptime_by_snmp.sh | 2025-04-02 19:38 | 1.9K | |
| check_updates.wsf | 2025-04-02 19:39 | 1.9K | |
| check_ichains_0.1.tgz | 2025-04-02 19:38 | 1.9K | |
| check_objage.pl | 2025-04-02 19:39 | 1.9K | |
| check_snmp_barracuda..> | 2025-04-02 19:38 | 1.9K | |
| perfmon.vbs.txt | 2025-04-02 19:39 | 1.9K | |
| dsdns.sh | 2025-04-02 19:38 | 1.9K | |
| check_winmem | 2025-04-02 19:39 | 1.9K | |
| check_netio | 2025-04-02 19:39 | 1.9K | |
| check_disksuite | 2025-04-02 19:39 | 1.9K | |
| check_diskwrite | 2025-04-02 19:39 | 1.9K | |
| check_myfilesize.pl | 2025-04-02 19:39 | 1.9K | |
| check_foundry_ports-..> | 2025-04-02 19:38 | 1.9K | |
| check_ps.php | 2025-04-02 19:39 | 1.9K | |
| check_esx_vdf.php | 2025-04-02 19:38 | 1.9K | |
| check_mpstat.pl | 2025-04-02 19:39 | 1.9K | |
| checkpoint.png | 2025-04-02 19:39 | 1.9K | |
| snmp_process-0.2.tar.gz | 2025-04-02 19:38 | 1.9K | |
| check_fs_grow | 2025-04-02 19:39 | 1.9K | |
| check_ucd | 2025-04-02 19:38 | 1.9K | |
| check_hacmp-1.0.tar.gz | 2025-04-02 19:39 | 2.0K | |
| check_netdiag.pl | 2025-04-02 19:39 | 2.0K | |
| check_dbmirroring.pl | 2025-04-02 19:39 | 2.0K | |
| nrpe | 2025-04-02 19:38 | 2.0K | |
| check_rsync-incr | 2025-04-02 19:38 | 2.0K | |
| services_HPPro.cfg | 2025-04-02 19:39 | 2.0K | |
| libplugins.pm | 2025-04-02 19:38 | 2.0K | |
| misc.pm | 2025-04-02 19:39 | 2.0K | |
| check_processes | 2025-04-02 19:38 | 2.0K | |
| check_arraydiskstate.sh | 2025-04-02 19:39 | 2.0K | |
| check_exchange_webma..> | 2025-04-02 19:38 | 2.0K | |
| nagios2lcd.png | 2025-04-02 19:38 | 2.0K | |
| check_reps.pl | 2025-04-02 19:39 | 2.0K | |
| check_netapp_space-0..> | 2025-04-02 19:39 | 2.0K | |
| chkwin_service_auto.zip | 2025-04-02 19:39 | 2.0K | |
| rittal_temp-v1.0.2.sh | 2025-04-02 19:40 | 2.0K | |
| check_pound_stat.pl | 2025-04-02 19:38 | 2.0K | |
| check_snmp_nortel_co..> | 2025-04-02 19:38 | 2.0K | |
| JVM_Weblogic.sh | 2025-04-02 19:39 | 2.0K | |
| check_snmp_snapshot.sh | 2025-04-02 19:39 | 2.1K | |
| check_amq.pl | 2025-04-02 19:38 | 2.1K | |
| check_3310 | 2025-04-02 19:39 | 2.1K | |
| autoinstall_nagios.t..> | 2025-04-02 19:38 | 2.1K | |
| check_aix_fsystems.zip | 2025-04-02 19:39 | 2.1K | |
| Check_Processes.ini | 2025-04-02 19:39 | 2.1K | |
| check_cisco_voice.cfg | 2025-04-02 19:38 | 2.1K | |
| check_proc_time.sh | 2025-04-02 19:39 | 2.1K | |
| smsnotify.cfg | 2025-04-02 19:39 | 2.1K | |
| check_frs.pl | 2025-04-02 19:39 | 2.1K | |
| check_vmware3.cfg | 2025-04-02 19:39 | 2.1K | |
| check_retro_client.txt | 2025-04-02 19:39 | 2.1K | |
| groupwise-mta.php | 2025-04-02 19:39 | 2.1K | |
| check_multipath | 2025-04-02 19:38 | 2.1K | |
| check_multipath.sh | 2025-04-02 19:38 | 2.1K | |
| notifications-0.3.ta..> | 2025-04-02 19:39 | 2.2K | |
| check_apacherequests.pl | 2025-04-02 19:38 | 2.2K | |
| check_iperf.pl | 2025-04-02 19:38 | 2.2K | |
| check_omsa_vdisk | 2025-04-02 19:39 | 2.2K | |
| snmptt.conf.vortex | 2025-04-02 19:39 | 2.2K | |
| check_rsa_temp2.sh | 2025-04-02 19:39 | 2.2K | |
| check_hopcount.pl | 2025-04-02 19:38 | 2.2K | |
| check_temp_dallas.pl | 2025-04-02 19:40 | 2.2K | |
| ocsp.init | 2025-04-02 19:39 | 2.2K | |
| check_iis_apppool_st..> | 2025-04-02 19:38 | 2.2K | |
| check_eximailqueue.txt | 2025-04-02 19:38 | 2.2K | |
| check_rsa_ambtemp.sh | 2025-04-02 19:38 | 2.2K | |
| check_areca | 2025-04-02 19:39 | 2.2K | |
| check_kdc | 2025-04-02 19:38 | 2.2K | |
| check_ndslogin.tgz | 2025-04-02 19:39 | 2.2K | |
| check_mem.pl.gz | 2025-04-02 19:38 | 2.2K | |
| services.cfg | 2025-04-02 19:40 | 2.2K | |
| check_hddtemp.sh | 2025-04-02 19:40 | 2.2K | |
| commands.cfg | 2025-04-02 19:38 | 2.2K | |
| check_stp_bridges.sh | 2025-04-02 19:40 | 2.2K | |
| check_gpfs_1.1 | 2025-04-02 19:40 | 2.2K | |
| mqueue_check-1.0.tar.gz | 2025-04-02 19:38 | 2.2K | |
| check_em1.tar.gz | 2025-04-02 19:40 | 2.2K | |
| check_activemq.pl | 2025-04-02 19:38 | 2.2K | |
| check_proftp_user | 2025-04-02 19:38 | 2.2K | |
| check_winmem.txt | 2025-04-02 19:39 | 2.2K | |
| check_dcm | 2025-04-02 19:39 | 2.3K | |
| check_nsca_devel.zip | 2025-04-02 19:39 | 2.3K | |
| check_service-1.1.zip | 2025-04-02 19:39 | 2.3K | |
| check_nodes.sh | 2025-04-02 19:38 | 2.3K | |
| check_mem.zip | 2025-04-02 19:38 | 2.3K | |
| check_rsa_fan4.sh | 2025-04-02 19:39 | 2.3K | |
| check_ftp.pl | 2025-04-02 19:38 | 2.3K | |
| snmp_disk-0.1.tar.gz | 2025-04-02 19:38 | 2.3K | |
| check_tacacs_plus.pl | 2025-04-02 19:38 | 2.3K | |
| check_snmp_load.sh | 2025-04-02 19:38 | 2.3K | |
| check_proftp_user.sh | 2025-04-02 19:38 | 2.3K | |
| check_win_processes | 2025-04-02 19:39 | 2.3K | |
| check_esx_networkper..> | 2025-04-02 19:38 | 2.3K | |
| check_msmq-0.2.zip | 2025-04-02 19:39 | 2.3K | |
| check_filesize_dir | 2025-04-02 19:39 | 2.3K | |
| check_mrv_rssi.pl | 2025-04-02 19:39 | 2.3K | |
| check_esx_networkper..> | 2025-04-02 19:38 | 2.3K | |
| check_zfs.tar.gz | 2025-04-02 19:39 | 2.3K | |
| check_vmware | 2025-04-02 19:39 | 2.3K | |
| reportsock.tar.gz | 2025-04-02 19:39 | 2.3K | |
| check_mem.txt | 2025-04-02 19:39 | 2.3K | |
| nrpe-tcp.xml | 2025-04-02 19:39 | 2.3K | |
| rittal_cmc-v1.0.3.sh | 2025-04-02 19:40 | 2.3K | |
| check_disk-1.13c.zip | 2025-04-02 19:39 | 2.4K | |
| check_fileage-1.1.zip | 2025-04-02 19:39 | 2.4K | |
| check_process_memory.sh | 2025-04-02 19:39 | 2.4K | |
| check_veritas.txt | 2025-04-02 19:39 | 2.4K | |
| check_bmc_ps | 2025-04-02 19:39 | 2.4K | |
| send_gmail.py | 2025-04-02 19:38 | 2.4K | |
| check_bmc_temp | 2025-04-02 19:39 | 2.4K | |
| check_eximailqueue_1.1 | 2025-04-02 19:38 | 2.4K | |
| utils.pm | 2025-04-02 19:39 | 2.4K | |
| check_nod32updatemir..> | 2025-04-02 19:38 | 2.4K | |
| check_named.txt | 2025-04-02 19:38 | 2.4K | |
| check_winhd | 2025-04-02 19:39 | 2.4K | |
| check_metastat.sh | 2025-04-02 19:39 | 2.4K | |
| installation_notes.txt | 2025-04-02 19:38 | 2.4K | |
| check_rrd_data.pl | 2025-04-02 19:39 | 2.4K | |
| check_network_link | 2025-04-02 19:38 | 2.4K | |
| check_procs_pgrep.ta..> | 2025-04-02 19:38 | 2.4K | |
| check_snmp_pkgvuln | 2025-04-02 19:38 | 2.4K | |
| check_mge_ups.rar | 2025-04-02 19:38 | 2.4K | |
| check_users.sh | 2025-04-02 19:38 | 2.4K | |
| check_disk_detail.sh | 2025-04-02 19:39 | 2.4K | |
| check_hpiml.tar.gz | 2025-04-02 19:38 | 2.4K | |
| dns_delegation-0.1.0..> | 2025-04-02 19:38 | 2.4K | |
| check_glusterfs.sh | 2025-04-02 19:39 | 2.4K | |
| check_snmp_globalsta..> | 2025-04-02 19:40 | 2.4K | |
| check_portaudit.tar.gz | 2025-04-02 19:39 | 2.4K | |
| check_system_TEMP_hp..> | 2025-04-02 19:39 | 2.5K | |
| chkwin_group.zip | 2025-04-02 19:39 | 2.5K | |
| process_runtime.vbs | 2025-04-02 19:39 | 2.5K | |
| nagios3-statusmap.patch | 2025-04-02 19:38 | 2.5K | |
| check_cisco_asa_091.zip | 2025-04-02 19:38 | 2.5K | |
| wmi-service.pl | 2025-04-02 19:39 | 2.5K | |
| readme.txt | 2025-04-02 19:39 | 2.5K | |
| check_mem.py | 2025-04-02 19:39 | 2.5K | |
| demo.cfg | 2025-04-02 19:39 | 2.5K | |
| check_mpt | 2025-04-02 19:38 | 2.5K | |
| check_tp_cpu.pl | 2025-04-02 19:38 | 2.5K | |
| check_ad_time.vbs | 2025-04-02 19:39 | 2.5K | |
| check_eximailqueue_1.2 | 2025-04-02 19:38 | 2.5K | |
| check_rsa_fan.sh | 2025-04-02 19:38 | 2.5K | |
| check_faxqueue | 2025-04-02 19:38 | 2.5K | |
| check_dns.pl | 2025-04-02 19:38 | 2.5K | |
| nagios2.4-statusmap...> | 2025-04-02 19:38 | 2.5K | |
| check_proc_count_nt | 2025-04-02 19:38 | 2.5K | |
| check_rsa_temp4.sh | 2025-04-02 19:39 | 2.5K | |
| check_nis_1.1 | 2025-04-02 19:38 | 2.5K | |
| check_asterisk_odbc_..> | 2025-04-02 19:38 | 2.5K | |
| check_tftp | 2025-04-02 19:38 | 2.5K | |
| check_telnet.pl | 2025-04-02 19:38 | 2.5K | |
| check_process-1.1.zip | 2025-04-02 19:39 | 2.5K | |
| check_all_disks_win.sh | 2025-04-02 19:39 | 2.6K | |
| chkwin_disk_time.zip | 2025-04-02 19:39 | 2.6K | |
| check_inivalue.pl-v0..> | 2025-04-02 19:38 | 2.6K | |
| check_ups_chloride | 2025-04-02 19:39 | 2.6K | |
| check_serverview | 2025-04-02 19:38 | 2.6K | |
| check_disk.zip | 2025-04-02 19:39 | 2.6K | |
| check_apc_env.rar | 2025-04-02 19:38 | 2.6K | |
| check_adaptecraid.ws..> | 2025-04-02 19:39 | 2.6K | |
| check_ws5000_ap.sh | 2025-04-02 19:38 | 2.6K | |
| check_ntp_s | 2025-04-02 19:38 | 2.6K | |
| chkwin_cputime-1.2.zip | 2025-04-02 19:39 | 2.6K | |
| check_mirror | 2025-04-02 19:39 | 2.6K | |
| check_bond.sh | 2025-04-02 19:39 | 2.6K | |
| rrdtraf-v0-1.tar.gz | 2025-04-02 19:38 | 2.6K | |
| check_hp_sata_raid.sh | 2025-04-02 19:39 | 2.6K | |
| test_log3.txt | 2025-04-02 19:39 | 2.6K | |
| check_tp_mem.pl | 2025-04-02 19:38 | 2.6K | |
| check_file_size.sh | 2025-04-02 19:39 | 2.6K | |
| check_netio_1.1 | 2025-04-02 19:39 | 2.6K | |
| check_dhcp_free.py | 2025-04-02 19:39 | 2.6K | |
| check_vg_size | 2025-04-02 19:39 | 2.6K | |
| check_perc5i.pl | 2025-04-02 19:39 | 2.6K | |
| check_nsca | 2025-04-02 19:39 | 2.7K | |
| check_mem_avail | 2025-04-02 19:38 | 2.7K | |
| check_nfsmount | 2025-04-02 19:40 | 2.7K | |
| check_asterisk_alive..> | 2025-04-02 19:38 | 2.7K | |
| check_snmp_brocade.rar | 2025-04-02 19:38 | 2.7K | |
| check_snmp_proliant_..> | 2025-04-02 19:38 | 2.7K | |
| check_apache2.php | 2025-04-02 19:39 | 2.7K | |
| check_apacheconcreq | 2025-04-02 19:38 | 2.7K | |
| check_fwm.txt | 2025-04-02 19:39 | 2.7K | |
| check_ftp-file.pl | 2025-04-02 19:38 | 2.7K | |
| check_snmp_heartbeat.sh | 2025-04-02 19:38 | 2.7K | |
| check_snmp_gauge-0.3..> | 2025-04-02 19:38 | 2.7K | |
| nocturnal_nagios_plu..> | 2025-04-02 19:38 | 2.7K | |
| check_quota | 2025-04-02 19:38 | 2.7K | |
| check_postfix.txt | 2025-04-02 19:38 | 2.7K | |
| check_ldap_fd | 2025-04-02 19:38 | 2.7K | |
| check_bigIP_snmp.pl | 2025-04-02 19:39 | 2.7K | |
| rexec-1.0.tgz | 2025-04-02 19:38 | 2.7K | |
| check_megaide.sh | 2025-04-02 19:39 | 2.7K | |
| check_primecluster | 2025-04-02 19:39 | 2.7K | |
| check_dell_amcli.wsf..> | 2025-04-02 19:39 | 2.7K | |
| check_rpc.gz | 2025-04-02 19:38 | 2.7K | |
| slope_rrd.pl | 2025-04-02 19:39 | 2.7K | |
| check_rbl | 2025-04-02 19:38 | 2.7K | |
| check_cpu.php | 2025-04-02 19:40 | 2.8K | |
| check_apc_emu.txt | 2025-04-02 19:38 | 2.8K | |
| gulm_lockspace | 2025-04-02 19:38 | 2.8K | |
| check_snmp_esx_snaps..> | 2025-04-02 19:39 | 2.8K | |
| check_snmp_vmfs.sh | 2025-04-02 19:39 | 2.8K | |
| check_mscs-0.2.zip | 2025-04-02 19:39 | 2.8K | |
| check_brocade | 2025-04-02 19:39 | 2.8K | |
| check_licenseserver.pl | 2025-04-02 19:39 | 2.8K | |
| check_max_clients_ro..> | 2025-04-02 19:39 | 2.8K | |
| check_sge_qping | 2025-04-02 19:38 | 2.8K | |
| remote_ctl.tgz | 2025-04-02 19:39 | 2.8K | |
| docbase_checks.tar.gz | 2025-04-02 19:38 | 2.8K | |
| check_iostat | 2025-04-02 19:39 | 2.8K | |
| check_sysctl-1.2.tar.gz | 2025-04-02 19:39 | 2.8K | |
| rap_rise_rrd.pl | 2025-04-02 19:39 | 2.8K | |
| check_hd.txt | 2025-04-02 19:39 | 2.8K | |
| check_mythtv.pl | 2025-04-02 19:38 | 2.8K | |
| check_dxml_drvstate_..> | 2025-04-02 19:39 | 2.8K | |
| rel-0.2.1.tar.gz | 2025-04-02 19:39 | 2.8K | |
| check_pm3_clients_ro..> | 2025-04-02 19:39 | 2.8K | |
| check-hp_iml | 2025-04-02 19:39 | 2.9K | |
| check_rittal_cmc.sh | 2025-04-02 19:40 | 2.9K | |
| check_ldap_master.py | 2025-04-02 19:38 | 2.9K | |
| check_horde_login.txt | 2025-04-02 19:38 | 2.9K | |
| check_uptime.pl | 2025-04-02 19:39 | 2.9K | |
| check_win_snmp_proce..> | 2025-04-02 19:39 | 2.9K | |
| check_snmp_int_by_ad..> | 2025-04-02 19:38 | 2.9K | |
| pat_match_rrd.pl | 2025-04-02 19:39 | 2.9K | |
| check_diskuse | 2025-04-02 19:39 | 2.9K | |
| check_p4_license | 2025-04-02 19:38 | 2.9K | |
| file_text_search.zip | 2025-04-02 19:39 | 2.9K | |
| tcpconncheck.pl | 2025-04-02 19:38 | 2.9K | |
| check_http_content | 2025-04-02 19:38 | 2.9K | |
| check_swraid.py | 2025-04-02 19:38 | 2.9K | |
| check_uptime | 2025-04-02 19:39 | 2.9K | |
| check_kernel_status | 2025-04-02 19:38 | 2.9K | |
| check_route | 2025-04-02 19:38 | 2.9K | |
| check_apcext.tgz | 2025-04-02 19:38 | 2.9K | |
| check_npower.pl | 2025-04-02 19:40 | 3.0K | |
| check_perc-103c.zip | 2025-04-02 19:39 | 3.0K | |
| hp_phydrv.php.txt | 2025-04-02 19:38 | 3.0K | |
| check_pcoweb.py | 2025-04-02 19:38 | 3.0K | |
| eventlog_src.zip | 2025-04-02 19:39 | 3.0K | |
| Check_be.txt | 2025-04-02 19:38 | 3.0K | |
| 1wire_temp.pl | 2025-04-02 19:40 | 3.0K | |
| check_file.pl | 2025-04-02 19:39 | 3.0K | |
| install_check_win_ev..> | 2025-04-02 19:39 | 3.0K | |
| check_rsa_fan8.sh | 2025-04-02 19:39 | 3.0K | |
| xmlsensors.tar_0.gz | 2025-04-02 19:39 | 3.0K | |
| check_ifspeed | 2025-04-02 19:39 | 3.0K | |
| check_apachestatus_a..> | 2025-04-02 19:38 | 3.0K | |
| check_dell_sensors.pl | 2025-04-02 19:39 | 3.1K | |
| check_jabber_login.pl | 2025-04-02 19:38 | 3.1K | |
| directory_file_count..> | 2025-04-02 19:39 | 3.1K | |
| check_bind.php | 2025-04-02 19:39 | 3.1K | |
| check_s3_usage.txt | 2025-04-02 19:40 | 3.1K | |
| check_apcems | 2025-04-02 19:40 | 3.1K | |
| check_disk_snmp | 2025-04-02 19:39 | 3.1K | |
| check_suse_updates.pl | 2025-04-02 19:38 | 3.1K | |
| lvm_resize | 2025-04-02 19:38 | 3.1K | |
| check_nb_errs-0.3.pl | 2025-04-02 19:38 | 3.1K | |
| check_complus-0.1.ZIP | 2025-04-02 19:39 | 3.1K | |
| check_ports-0.5.6.ta..> | 2025-04-02 19:39 | 3.1K | |
| check_cnr.txt | 2025-04-02 19:39 | 3.1K | |
| check_httpproxy.sh | 2025-04-02 19:38 | 3.1K | |
| check_hylafax | 2025-04-02 19:38 | 3.1K | |
| check_tcping-0.1.5.t..> | 2025-04-02 19:38 | 3.1K | |
| check_esx_cpu | 2025-04-02 19:39 | 3.2K | |
| check_hplog | 2025-04-02 19:38 | 3.2K | |
| check_disk.vbs.txt | 2025-04-02 19:39 | 3.2K | |
| check_nmb | 2025-04-02 19:38 | 3.2K | |
| check_gfs_counters | 2025-04-02 19:38 | 3.2K | |
| check_mqseries | 2025-04-02 19:38 | 3.2K | |
| check_eximailqueue_1.3 | 2025-04-02 19:38 | 3.2K | |
| akcp_con_nagios.txt | 2025-04-02 19:38 | 3.2K | |
| check_arcconf | 2025-04-02 19:39 | 3.2K | |
| check_geom.sh | 2025-04-02 19:39 | 3.2K | |
| check_rsa_temp8.sh | 2025-04-02 19:39 | 3.3K | |
| vmware.nagios | 2025-04-02 19:39 | 3.3K | |
| check_nis_1.2 | 2025-04-02 19:38 | 3.3K | |
| check_fusi_fan.sh | 2025-04-02 19:39 | 3.3K | |
| check_php_sess_1.2 | 2025-04-02 19:38 | 3.3K | |
| check_backup_log.cfg | 2025-04-02 19:38 | 3.3K | |
| check_timestamp | 2025-04-02 19:38 | 3.3K | |
| check_systime-105.zip | 2025-04-02 19:38 | 3.3K | |
| check_proxy.sh | 2025-04-02 19:38 | 3.3K | |
| check_rsa_temp | 2025-04-02 19:38 | 3.3K | |
| check_ac.pl | 2025-04-02 19:40 | 3.3K | |
| check_vmware_server.sh | 2025-04-02 19:38 | 3.3K | |
| check_open_files.pl | 2025-04-02 19:39 | 3.3K | |
| check_backup_log.txt | 2025-04-02 19:38 | 3.3K | |
| check_esx_wbem.py | 2025-04-02 19:39 | 3.3K | |
| check_ntp_config.txt | 2025-04-02 19:38 | 3.3K | |
| check_netio.ncfg | 2025-04-02 19:39 | 3.4K | |
| check_apachestatus_a..> | 2025-04-02 19:38 | 3.4K | |
| check_dell_hw.pl | 2025-04-02 19:39 | 3.4K | |
| check_hp_verbrauchsm..> | 2025-04-02 19:39 | 3.4K | |
| check_hparray.pl | 2025-04-02 19:39 | 3.4K | |
| check_snmp4ctx_wfact..> | 2025-04-02 19:39 | 3.4K | |
| check_procs2 | 2025-04-02 19:39 | 3.4K | |
| CIPS-Sample-Nagios-C..> | 2025-04-02 19:39 | 3.4K | |
| irc.py | 2025-04-02 19:39 | 3.4K | |
| check_apacheconcreq_1.1 | 2025-04-02 19:38 | 3.4K | |
| check_tp_fs.pl | 2025-04-02 19:38 | 3.4K | |
| ibcheckerrs_patched | 2025-04-02 19:39 | 3.4K | |
| check_windows_update.pl | 2025-04-02 19:39 | 3.4K | |
| check_debian_packages | 2025-04-02 19:39 | 3.4K | |
| check_ldap_replicati..> | 2025-04-02 19:38 | 3.4K | |
| check_vitals | 2025-04-02 19:39 | 3.5K | |
| check_snmp_hp-hardwa..> | 2025-04-02 19:39 | 3.5K | |
| check_1-wiretemp | 2025-04-02 19:40 | 3.5K | |
| check_ssl_cert.php | 2025-04-02 19:38 | 3.5K | |
| check_msupdate.wsf.txt | 2025-04-02 19:39 | 3.5K | |
| dumper.py | 2025-04-02 19:39 | 3.5K | |
| check_aix_disks.php | 2025-04-02 19:39 | 3.5K | |
| check_all_disks | 2025-04-02 19:39 | 3.5K | |
| check_traffic | 2025-04-02 19:38 | 3.5K | |
| check_nagiosPerf | 2025-04-02 19:39 | 3.5K | |
| NetApp_nagios_check.txt | 2025-04-02 19:39 | 3.5K | |
| check_iax-1.0.0.tar.gz | 2025-04-02 19:38 | 3.5K | |
| check_snmp_dell-hard..> | 2025-04-02 19:39 | 3.5K | |
| check_al1297.tar.gz | 2025-04-02 19:39 | 3.5K | |
| check_asterisk | 2025-04-02 19:38 | 3.5K | |
| check_rsa_temp.sh | 2025-04-02 19:38 | 3.5K | |
| snmp-bulk-check.pl | 2025-04-02 19:38 | 3.5K | |
| check_nb_jukebox-0.2.pl | 2025-04-02 19:38 | 3.5K | |
| check_ifpingok | 2025-04-02 19:38 | 3.5K | |
| check_openbsd_mem.sh | 2025-04-02 19:39 | 3.6K | |
| check_bonding.pl | 2025-04-02 19:38 | 3.6K | |
| check_redund_switch.pl | 2025-04-02 19:39 | 3.6K | |
| check_dpt | 2025-04-02 19:39 | 3.6K | |
| check_hgsc_ftp | 2025-04-02 19:38 | 3.6K | |
| stingray_isdn_nagios.sh | 2025-04-02 19:39 | 3.6K | |
| check_ad_fsmo.vbs | 2025-04-02 19:39 | 3.6K | |
| check_sybase-0.7.zip | 2025-04-02 19:39 | 3.6K | |
| check_system_procs | 2025-04-02 19:39 | 3.6K | |
| check_rrd_bw.sh | 2025-04-02 19:39 | 3.6K | |
| check_tftp.pl | 2025-04-02 19:38 | 3.6K | |
| check_radius.pl | 2025-04-02 19:38 | 3.7K | |
| check_ataboy | 2025-04-02 19:39 | 3.7K | |
| check_rhcluster.py | 2025-04-02 19:38 | 3.7K | |
| check_rsync | 2025-04-02 19:40 | 3.7K | |
| bbnt2ns-1.1.tar.gz | 2025-04-02 19:39 | 3.7K | |
| check_system_procs2 | 2025-04-02 19:39 | 3.7K | |
| profile_nagios_execu..> | 2025-04-02 19:39 | 3.7K | |
| check_nfsmounts | 2025-04-02 19:38 | 3.7K | |
| check_mem | 2025-04-02 19:38 | 3.7K | |
| check_process_remote | 2025-04-02 19:39 | 3.7K | |
| check_numoffiles.sh | 2025-04-02 19:39 | 3.7K | |
| retrieve_custom_snmp | 2025-04-02 19:38 | 3.7K | |
| check_ro_mounts | 2025-04-02 19:38 | 3.8K | |
| check_iis | 2025-04-02 19:38 | 3.8K | |
| python-setuid.c | 2025-04-02 19:38 | 3.8K | |
| check_adic.pl | 2025-04-02 19:40 | 3.8K | |
| check_om_chassis.pl | 2025-04-02 19:39 | 3.8K | |
| mySNMPagent.php | 2025-04-02 19:39 | 3.8K | |
| check_kadmin.pl | 2025-04-02 19:38 | 3.8K | |
| check_dirsize.sh | 2025-04-02 19:39 | 3.8K | |
| check_rsa_fan | 2025-04-02 19:38 | 3.8K | |
| check_swap_sl | 2025-04-02 19:38 | 3.8K | |
| check_xserve.py | 2025-04-02 19:39 | 3.8K | |
| check_snmp_if_max-0...> | 2025-04-02 19:38 | 3.8K | |
| check_pcmeasure.tgz | 2025-04-02 19:40 | 3.9K | |
| check_otrsuser.pl | 2025-04-02 19:38 | 3.9K | |
| check_dovecot | 2025-04-02 19:38 | 3.9K | |
| check-duplex-speed.php | 2025-04-02 19:38 | 3.9K | |
| check_rsnapshot.pl | 2025-04-02 19:38 | 3.9K | |
| check_rsacm.sh | 2025-04-02 19:38 | 3.9K | |
| check_netscaler_cpu.pl | 2025-04-02 19:38 | 3.9K | |
| check_sensorprobe | 2025-04-02 19:40 | 3.9K | |
| check_snmp_apc_pdu.t..> | 2025-04-02 19:38 | 4.0K | |
| filesize.pl | 2025-04-02 19:39 | 4.0K | |
| check_snmp_string.pl | 2025-04-02 19:38 | 4.0K | |
| check_windows_update..> | 2025-04-02 19:39 | 4.0K | |
| check_3ware.pl | 2025-04-02 19:39 | 4.0K | |
| check_nomadix_esp | 2025-04-02 19:38 | 4.0K | |
| check_afacli.pl | 2025-04-02 19:39 | 4.0K | |
| check_netapp_health.pl | 2025-04-02 19:40 | 4.0K | |
| check_Exchange_backu..> | 2025-04-02 19:39 | 4.0K | |
| check_asa_sessions.pl | 2025-04-02 19:38 | 4.0K | |
| 3ware.pl | 2025-04-02 19:39 | 4.0K | |
| check_windows_update..> | 2025-04-02 19:39 | 4.0K | |
| eventlog_bin.zip | 2025-04-02 19:39 | 4.0K | |
| check_bl_async.pl | 2025-04-02 19:38 | 4.0K | |
| check_siemens_hipath | 2025-04-02 19:39 | 4.1K | |
| check_faxq | 2025-04-02 19:38 | 4.1K | |
| check-aacraid.py | 2025-04-02 19:39 | 4.1K | |
| check_dhcp.pl | 2025-04-02 19:38 | 4.1K | |
| check_pkgchk | 2025-04-02 19:39 | 4.1K | |
| ocsp_sweeper_pl.source | 2025-04-02 19:39 | 4.1K | |
| check_disk.sh | 2025-04-02 19:38 | 4.1K | |
| vmware-host.mrtg | 2025-04-02 19:39 | 4.1K | |
| check_tina.pl | 2025-04-02 19:38 | 4.1K | |
| nagios2lcd.pl | 2025-04-02 19:38 | 4.1K | |
| check_pf_carp.php | 2025-04-02 19:38 | 4.1K | |
| check_krb5.txt | 2025-04-02 19:38 | 4.1K | |
| check_sybase-0.8.zip | 2025-04-02 19:39 | 4.1K | |
| check_cisco_vlan_mem..> | 2025-04-02 19:39 | 4.1K | |
| check_snmp_cisco_por..> | 2025-04-02 19:40 | 4.2K | |
| check_ipsec | 2025-04-02 19:38 | 4.2K | |
| check_fsc-0.0.1.tar.gz | 2025-04-02 19:39 | 4.2K | |
| check_ram | 2025-04-02 19:39 | 4.2K | |
| check_schedulered.c | 2025-04-02 19:38 | 4.2K | |
| check_diskspace.sh | 2025-04-02 19:38 | 4.2K | |
| check_relayd_status.pl | 2025-04-02 19:39 | 4.2K | |
| check_system_pp | 2025-04-02 19:39 | 4.2K | |
| akcp.gif | 2025-04-02 19:38 | 4.2K | |
| check_hadoop-dfs.sh | 2025-04-02 19:39 | 4.2K | |
| check_snmp_vmware_vm..> | 2025-04-02 19:39 | 4.2K | |
| check_dirsize11.sh | 2025-04-02 19:39 | 4.2K | |
| check_ifspeed.txt | 2025-04-02 19:38 | 4.2K | |
| snmp_control.sh | 2025-04-02 19:38 | 4.3K | |
| check_bgp_neighbors.sh | 2025-04-02 19:38 | 4.3K | |
| check_win_snmp_stora..> | 2025-04-02 19:39 | 4.3K | |
| check_Forti_Cluster1.pl | 2025-04-02 19:38 | 4.3K | |
| check_fsc-0.2.tar.gz | 2025-04-02 19:39 | 4.3K | |
| check_dell_sensors.w..> | 2025-04-02 19:39 | 4.4K | |
| send_mail.pl | 2025-04-02 19:38 | 4.4K | |
| RTR.rar | 2025-04-02 19:39 | 4.4K | |
| check_ipmi_sensors.pl | 2025-04-02 19:39 | 4.4K | |
| check_pix_failover | 2025-04-02 19:38 | 4.4K | |
| check_memhpux | 2025-04-02 19:39 | 4.4K | |
| check_temperature_tme | 2025-04-02 19:40 | 4.4K | |
| check_netapp_space-0..> | 2025-04-02 19:39 | 4.4K | |
| srcd_suse | 2025-04-02 19:39 | 4.4K | |
| check_hparray | 2025-04-02 19:39 | 4.4K | |
| check_esxvm.pl | 2025-04-02 19:39 | 4.4K | |
| check_sap_backup.sh | 2025-04-02 19:38 | 4.4K | |
| check_2300dl | 2025-04-02 19:39 | 4.5K | |
| check_Forti_Cluster2.pl | 2025-04-02 19:38 | 4.5K | |
| RmiLookupTest.class | 2025-04-02 19:38 | 4.5K | |
| check_ldap.pl | 2025-04-02 19:38 | 4.5K | |
| check_sybase-1.0.zip | 2025-04-02 19:39 | 4.5K | |
| check_memory.pl | 2025-04-02 19:38 | 4.5K | |
| check_asterisk_odbc_..> | 2025-04-02 19:38 | 4.5K | |
| create_ticket.pl | 2025-04-02 19:39 | 4.5K | |
| check_mrtg_diff.pl | 2025-04-02 19:38 | 4.5K | |
| check_gwweb.pl | 2025-04-02 19:39 | 4.6K | |
| check_sms3status.pl | 2025-04-02 19:39 | 4.6K | |
| check_axfr | 2025-04-02 19:38 | 4.6K | |
| check_threads_load.py | 2025-04-02 19:39 | 4.6K | |
| check_vquota | 2025-04-02 19:38 | 4.7K | |
| check_sybase-1.1.zip | 2025-04-02 19:39 | 4.7K | |
| check_jk_status | 2025-04-02 19:39 | 4.7K | |
| check_perfcnt.pl | 2025-04-02 19:39 | 4.7K | |
| check_vmware2.pl | 2025-04-02 19:39 | 4.7K | |
| check_netscaler_conn.pl | 2025-04-02 19:38 | 4.7K | |
| proclog_01a.tar.gz | 2025-04-02 19:39 | 4.7K | |
| check_ace_failover | 2025-04-02 19:38 | 4.8K | |
| RmiLookupTest.java | 2025-04-02 19:38 | 4.8K | |
| elwatch.pl | 2025-04-02 19:39 | 4.8K | |
| check_octopussy.pl | 2025-04-02 19:38 | 4.8K | |
| check_latestfile.pl | 2025-04-02 19:39 | 4.8K | |
| check_https_cert.txt | 2025-04-02 19:38 | 4.8K | |
| check_rrdtraf-0.5.ta..> | 2025-04-02 19:39 | 4.8K | |
| check_cups_queue | 2025-04-02 19:38 | 4.9K | |
| check_insight_log.sh | 2025-04-02 19:39 | 4.9K | |
| check_netapp_space-0..> | 2025-04-02 19:39 | 4.9K | |
| check_lvm | 2025-04-02 19:38 | 4.9K | |
| check_intel_raid.pl | 2025-04-02 19:39 | 4.9K | |
| check_sip | 2025-04-02 19:38 | 4.9K | |
| check_sfan.pl | 2025-04-02 19:40 | 4.9K | |
| check_crl | 2025-04-02 19:38 | 4.9K | |
| check_listen_tcp_udp.sh | 2025-04-02 19:38 | 4.9K | |
| check_reasonable_fol..> | 2025-04-02 19:39 | 4.9K | |
| jmeter.pl | 2025-04-02 19:38 | 5.0K | |
| check_failover.py | 2025-04-02 19:38 | 5.0K | |
| check_sbc_stats.py | 2025-04-02 19:39 | 5.0K | |
| check_fortigate_memory | 2025-04-02 19:39 | 5.0K | |
| check_fortigate_session | 2025-04-02 19:39 | 5.0K | |
| check_perc-104.zip | 2025-04-02 19:39 | 5.0K | |
| check_if | 2025-04-02 19:39 | 5.0K | |
| check_digitemp.sh | 2025-04-02 19:40 | 5.0K | |
| repairer-master-0.4...> | 2025-04-02 19:39 | 5.1K | |
| check_senturion.pl | 2025-04-02 19:40 | 5.1K | |
| check_vxvm | 2025-04-02 19:38 | 5.1K | |
| check_netscreen_cpu | 2025-04-02 19:38 | 5.1K | |
| check_npower.plx | 2025-04-02 19:40 | 5.1K | |
| check_apc_ups.rar | 2025-04-02 19:38 | 5.2K | |
| send_nsca.pl | 2025-04-02 19:39 | 5.2K | |
| snmptrapd.conf | 2025-04-02 19:39 | 5.2K | |
| check_heartbeat_link..> | 2025-04-02 19:39 | 5.2K | |
| check_connections.pl | 2025-04-02 19:40 | 5.2K | |
| check_snmp_temps_pro..> | 2025-04-02 19:38 | 5.2K | |
| check_disk_all | 2025-04-02 19:39 | 5.2K | |
| check_heartbeat_link..> | 2025-04-02 19:39 | 5.2K | |
| check_netscreen_session | 2025-04-02 19:38 | 5.2K | |
| check_mem.pl | 2025-04-02 19:38 | 5.3K | |
| check_mssql_sproc.pl | 2025-04-02 19:39 | 5.3K | |
| check_mcpu | 2025-04-02 19:38 | 5.3K | |
| check_smart_attributes | 2025-04-02 19:38 | 5.3K | |
| check_fusi_fan.pl | 2025-04-02 19:39 | 5.3K | |
| check_perc5i | 2025-04-02 19:39 | 5.3K | |
| check_ipp.pl | 2025-04-02 19:39 | 5.3K | |
| check_snmp_citrix | 2025-04-02 19:38 | 5.3K | |
| check_smb_shares.pl | 2025-04-02 19:39 | 5.3K | |
| vmware.mrtg | 2025-04-02 19:39 | 5.3K | |
| check_fileage.py | 2025-04-02 19:38 | 5.3K | |
| disk_by_snmp.sh | 2025-04-02 19:38 | 5.3K | |
| smart_send_nsca.pl | 2025-04-02 19:39 | 5.4K | |
| check_apache2logs | 2025-04-02 19:39 | 5.4K | |
| check_apcupsd.txt | 2025-04-02 19:39 | 5.4K | |
| Check_HTTP_Requisite..> | 2025-04-02 19:38 | 5.4K | |
| check_blackberry.pl | 2025-04-02 19:39 | 5.4K | |
| check_mail_system.py | 2025-04-02 19:38 | 5.4K | |
| check_winsvc | 2025-04-02 19:39 | 5.4K | |
| check_netsnmp | 2025-04-02 19:38 | 5.4K | |
| sa2000.tar.gz | 2025-04-02 19:39 | 5.4K | |
| check_load_remote | 2025-04-02 19:39 | 5.4K | |
| get_snmp.php.gz | 2025-04-02 19:38 | 5.4K | |
| check_ssl_certificate | 2025-04-02 19:38 | 5.4K | |
| check_barracuda_queu..> | 2025-04-02 19:38 | 5.4K | |
| check_cpu.txt | 2025-04-02 19:39 | 5.5K | |
| check_dxml_drvstate_..> | 2025-04-02 19:39 | 5.5K | |
| check_snmp_wintemp.txt | 2025-04-02 19:39 | 5.5K | |
| check_heartbeat_link | 2025-04-02 19:39 | 5.5K | |
| check_bigip_vs | 2025-04-02 19:39 | 5.5K | |
| check_rhcs | 2025-04-02 19:38 | 5.5K | |
| check_rsync2 | 2025-04-02 19:40 | 5.5K | |
| check_snmp_service.2.1 | 2025-04-02 19:40 | 5.5K | |
| check_openvpn.pl | 2025-04-02 19:38 | 5.5K | |
| check_cacti_thold.0...> | 2025-04-02 19:38 | 5.5K | |
| check_time_snmp.pl | 2025-04-02 19:38 | 5.5K | |
| check_dxml_drvstate_..> | 2025-04-02 19:39 | 5.5K | |
| check_sun_hw_490 | 2025-04-02 19:39 | 5.5K | |
| check_dxml_drvstate_..> | 2025-04-02 19:39 | 5.6K | |
| handle-dell-openmana..> | 2025-04-02 19:39 | 5.6K | |
| check_udp-packet-los..> | 2025-04-02 19:40 | 5.6K | |
| check_cpq.txt | 2025-04-02 19:39 | 5.6K | |
| check_snmp_counter-0..> | 2025-04-02 19:38 | 5.6K | |
| check_raid_megarc.pl | 2025-04-02 19:38 | 5.6K | |
| check_gwpoa.pl | 2025-04-02 19:39 | 5.7K | |
| check_ncipher.sh | 2025-04-02 19:39 | 5.7K | |
| check_bacula_log.pl.txt | 2025-04-02 19:38 | 5.7K | |
| check_x509cert.pl | 2025-04-02 19:38 | 5.7K | |
| check_xen | 2025-04-02 19:38 | 5.7K | |
| check_fiona_loginCou..> | 2025-04-02 19:38 | 5.7K | |
| check_wow | 2025-04-02 19:38 | 5.8K | |
| check_user_implement..> | 2025-04-02 19:39 | 5.8K | |
| check_disk_remote | 2025-04-02 19:39 | 5.8K | |
| check_elwatch.pl | 2025-04-02 19:39 | 5.8K | |
| check_uptime_remote | 2025-04-02 19:39 | 5.8K | |
| check_ps.sh | 2025-04-02 19:39 | 5.9K | |
| check_fileage_remote | 2025-04-02 19:39 | 5.9K | |
| repairer-0.4.5-1.noa..> | 2025-04-02 19:39 | 5.9K | |
| check_dovecot_1.2 | 2025-04-02 19:38 | 5.9K | |
| check_ups_socomec.txt | 2025-04-02 19:38 | 5.9K | |
| nagxmlstatus.cgi | 2025-04-02 19:38 | 5.9K | |
| check_apache_status | 2025-04-02 19:40 | 5.9K | |
| check_netstat_remote | 2025-04-02 19:39 | 6.0K | |
| check_zlm_zen_queue.sh | 2025-04-02 19:39 | 6.0K | |
| check_http.pl | 2025-04-02 19:38 | 6.0K | |
| check_sge.py | 2025-04-02 19:39 | 6.0K | |
| check_lpstat.pl | 2025-04-02 19:38 | 6.0K | |
| check_mylexraid.pl | 2025-04-02 19:39 | 6.0K | |
| check_exim_input | 2025-04-02 19:38 | 6.0K | |
| check_mbmon.pl | 2025-04-02 19:38 | 6.0K | |
| check_fileages_remote | 2025-04-02 19:38 | 6.1K | |
| check_cpq1 | 2025-04-02 19:39 | 6.1K | |
| check_ups_socomec.py | 2025-04-02 19:38 | 6.1K | |
| check_md_raid | 2025-04-02 19:39 | 6.1K | |
| check_FCBrocade_hard..> | 2025-04-02 19:39 | 6.1K | |
| check_ospf.0.1.pl | 2025-04-02 19:38 | 6.1K | |
| check_ironport.sh | 2025-04-02 19:39 | 6.1K | |
| check_allnet.tar.bz2 | 2025-04-02 19:40 | 6.1K | |
| check_print_toner | 2025-04-02 19:38 | 6.1K | |
| check_asterisk_channels | 2025-04-02 19:38 | 6.2K | |
| check_om.py | 2025-04-02 19:39 | 6.2K | |
| check_smokeping.pl | 2025-04-02 19:38 | 6.2K | |
| check_iferrors.pl | 2025-04-02 19:38 | 6.2K | |
| snortlogo.tgz | 2025-04-02 19:39 | 6.2K | |
| check_cpu.sh | 2025-04-02 19:40 | 6.2K | |
| elog_source.zip | 2025-04-02 19:39 | 6.2K | |
| check_sensors | 2025-04-02 19:39 | 6.3K | |
| check_snmp_mgeups-0...> | 2025-04-02 19:38 | 6.3K | |
| check_raid.pl | 2025-04-02 19:39 | 6.3K | |
| check_pop3_subject.pl | 2025-04-02 19:38 | 6.3K | |
| check_serveraid | 2025-04-02 19:39 | 6.4K | |
| process-service-perf..> | 2025-04-02 19:38 | 6.4K | |
| check_smokeping.0.2.pl | 2025-04-02 19:38 | 6.4K | |
| check_ups.0.1.pl | 2025-04-02 19:39 | 6.4K | |
| check_logs.pl | 2025-04-02 19:38 | 6.4K | |
| check_dell_powerconn..> | 2025-04-02 19:39 | 6.4K | |
| get_snmp-1.6.php.gz | 2025-04-02 19:38 | 6.5K | |
| check_idm_sync.sh | 2025-04-02 19:39 | 6.5K | |
| check_bacula.pl | 2025-04-02 19:38 | 6.5K | |
| check_rdiff | 2025-04-02 19:38 | 6.5K | |
| check_cisco.pl | 2025-04-02 19:39 | 6.5K | |
| check_scheduler.pl | 2025-04-02 19:38 | 6.5K | |
| check_clamav | 2025-04-02 19:38 | 6.5K | |
| check_3com | 2025-04-02 19:39 | 6.5K | |
| imagepack-ubuntu.tar.gz | 2025-04-02 19:39 | 6.5K | |
| check_wsc_v14.pl | 2025-04-02 19:39 | 6.5K | |
| repairer-0.4.5.tar.gz | 2025-04-02 19:39 | 6.6K | |
| check_fortigate_vpn | 2025-04-02 19:39 | 6.6K | |
| plugin_command_wrapp..> | 2025-04-02 19:38 | 6.6K | |
| nagstat.sh | 2025-04-02 19:39 | 6.6K | |
| check_qpage-0.2 | 2025-04-02 19:38 | 6.6K | |
| boxbackup-plugins-0...> | 2025-04-02 19:39 | 6.6K | |
| check_netflow_database | 2025-04-02 19:38 | 6.6K | |
| check_snmp_cisco_sta..> | 2025-04-02 19:39 | 6.6K | |
| check_load2.txt | 2025-04-02 19:38 | 6.6K | |
| check_em1.pl | 2025-04-02 19:40 | 6.6K | |
| check_qpage | 2025-04-02 19:38 | 6.7K | |
| check_dovecot_1.3 | 2025-04-02 19:38 | 6.7K | |
| check_temp_net_client.c | 2025-04-02 19:40 | 6.7K | |
| check_spamd.pl | 2025-04-02 19:38 | 6.7K | |
| check_cpuwaitdisk.pl | 2025-04-02 19:39 | 6.7K | |
| submit_event_data.pl | 2025-04-02 19:39 | 6.7K | |
| check_megaraid_sas | 2025-04-02 19:39 | 6.7K | |
| check_munin.pl | 2025-04-02 19:38 | 6.7K | |
| check_snmp_brocade | 2025-04-02 19:40 | 6.7K | |
| check_bigip_vs_202 | 2025-04-02 19:39 | 6.8K | |
| show_users.txt | 2025-04-02 19:38 | 6.8K | |
| check_sun_hardware | 2025-04-02 19:39 | 6.8K | |
| check_dbtuna.php | 2025-04-02 19:39 | 6.8K | |
| check_apache2.py | 2025-04-02 19:38 | 6.8K | |
| check_mail.pl | 2025-04-02 19:38 | 6.9K | |
| check_win_snmp_disk.pl | 2025-04-02 19:39 | 6.9K | |
| check_nginx.sh | 2025-04-02 19:39 | 6.9K | |
| check_log2 | 2025-04-02 19:39 | 7.0K | |
| check_hwinfo.README.txt | 2025-04-02 19:39 | 7.0K | |
| check_snmp_cisco_tra..> | 2025-04-02 19:39 | 7.0K | |
| check_cpu_stats.ncfg | 2025-04-02 19:39 | 7.0K | |
| check_multiprocs.tar | 2025-04-02 19:38 | 7.0K | |
| check_zeomonitor.py | 2025-04-02 19:39 | 7.0K | |
| check_icp | 2025-04-02 19:39 | 7.0K | |
| avail_timeperiods.patch | 2025-04-02 19:38 | 7.1K | |
| check_gwia.pl | 2025-04-02 19:39 | 7.1K | |
| check_snmp_isl_broca..> | 2025-04-02 19:40 | 7.1K | |
| check_pop3_account.1..> | 2025-04-02 19:38 | 7.1K | |
| check_scmxx_info | 2025-04-02 19:39 | 7.2K | |
| check_squid.pl | 2025-04-02 19:38 | 7.2K | |
| Gtp.pm | 2025-04-02 19:40 | 7.2K | |
| check_percentage.pl | 2025-04-02 19:38 | 7.2K | |
| multiplexer.pl | 2025-04-02 19:40 | 7.3K | |
| bluecoat.zip | 2025-04-02 19:39 | 7.3K | |
| Nagios-WebTransact-T..> | 2025-04-02 19:38 | 7.3K | |
| check_cpu_stats.sh | 2025-04-02 19:39 | 7.3K | |
| check_snmp_isl_broca..> | 2025-04-02 19:40 | 7.3K | |
| check_mboxsize.wsf | 2025-04-02 19:39 | 7.3K | |
| check_snmp_mssql | 2025-04-02 19:39 | 7.4K | |
| check_cisco_envmon.pl | 2025-04-02 19:40 | 7.4K | |
| check_netscreen_vpn | 2025-04-02 19:38 | 7.4K | |
| check_netscreen_ids | 2025-04-02 19:38 | 7.4K | |
| check_apachestatus.pl | 2025-04-02 19:38 | 7.4K | |
| check_ssl_cert_alter..> | 2025-04-02 19:38 | 7.5K | |
| ajax_search_box.txt | 2025-04-02 19:39 | 7.5K | |
| check_edir_ldap_stat..> | 2025-04-02 19:39 | 7.5K | |
| check_infortrend | 2025-04-02 19:40 | 7.5K | |
| Nagios-Cmd-0.05.tar.gz | 2025-04-02 19:38 | 7.6K | |
| check_cisco_envmon.0..> | 2025-04-02 19:40 | 7.6K | |
| check_snmp_lmsensors.pl | 2025-04-02 19:38 | 7.7K | |
| _check_edir_ldap_sta..> | 2025-04-02 19:39 | 7.7K | |
| check_netscreen_mem | 2025-04-02 19:38 | 7.7K | |
| check_foundry | 2025-04-02 19:39 | 7.7K | |
| check_dns_host.pl | 2025-04-02 19:38 | 7.7K | |
| check_bigip_pool_201 | 2025-04-02 19:39 | 7.8K | |
| Check_Processes.vbs | 2025-04-02 19:39 | 7.8K | |
| check_cisco_free_int..> | 2025-04-02 19:39 | 7.8K | |
| check_hwinfo.wsf.txt | 2025-04-02 19:39 | 7.8K | |
| check_apache2.sh | 2025-04-02 19:39 | 7.8K | |
| check_snmp_vmware_gu..> | 2025-04-02 19:39 | 7.9K | |
| check_cisco_ping | 2025-04-02 19:39 | 7.9K | |
| centos.zip | 2025-04-02 19:39 | 7.9K | |
| check_cciss-1.8 | 2025-04-02 19:39 | 7.9K | |
| check_351x.txt | 2025-04-02 19:39 | 7.9K | |
| nsca_wrapper | 2025-04-02 19:38 | 7.9K | |
| check_log3 | 2025-04-02 19:39 | 7.9K | |
| check_gwmta.pl | 2025-04-02 19:39 | 8.0K | |
| check_curl.php | 2025-04-02 19:39 | 8.1K | |
| smart_notify_mail.pl | 2025-04-02 19:39 | 8.1K | |
| check_trafficlimit.pl | 2025-04-02 19:38 | 8.1K | |
| nagios-check_bl-1.0...> | 2025-04-02 19:38 | 8.1K | |
| check_dell_aacraid.pl | 2025-04-02 19:39 | 8.1K | |
| check_if_out_errors | 2025-04-02 19:38 | 8.1K | |
| check_linux_procstat..> | 2025-04-02 19:39 | 8.2K | |
| check_snmp_vmware_me..> | 2025-04-02 19:39 | 8.2K | |
| show_users.sh | 2025-04-02 19:38 | 8.2K | |
| nagiosplugins-1.0.ta..> | 2025-04-02 19:38 | 8.2K | |
| check_scstat.pl | 2025-04-02 19:39 | 8.2K | |
| check_bgp.pl | 2025-04-02 19:38 | 8.2K | |
| check_snmp_HP_Blades..> | 2025-04-02 19:39 | 8.2K | |
| check_dell_omreport.pl | 2025-04-02 19:39 | 8.2K | |
| check_cisco_firewall.sh | 2025-04-02 19:40 | 8.3K | |
| check_t3.pl | 2025-04-02 19:40 | 8.3K | |
| squid.tar.gz | 2025-04-02 19:39 | 8.3K | |
| nagiosCfgVisualizer.sh | 2025-04-02 19:38 | 8.3K | |
| check_snmp_if-0.6.ta..> | 2025-04-02 19:38 | 8.3K | |
| check_zaptel-0.9.1.t..> | 2025-04-02 19:39 | 8.3K | |
| check_bgp.0.3.pl | 2025-04-02 19:38 | 8.4K | |
| check_smartmon.txt | 2025-04-02 19:38 | 8.4K | |
| check_perc.pl | 2025-04-02 19:39 | 8.4K | |
| check_nagios_latency..> | 2025-04-02 19:39 | 8.4K | |
| check_all_interfaces.pl | 2025-04-02 19:39 | 8.4K | |
| check_solaris_swap_1..> | 2025-04-02 19:39 | 8.5K | |
| check_mssql_monitor | 2025-04-02 19:39 | 8.7K | |
| nagios-check_sip-1.0..> | 2025-04-02 19:38 | 8.7K | |
| check_solaris_swap_1..> | 2025-04-02 19:39 | 8.7K | |
| check_teaming_broadcom | 2025-04-02 19:39 | 8.7K | |
| source.txt | 2025-04-02 19:38 | 8.7K | |
| check_snmp_megaraid.pl | 2025-04-02 19:38 | 8.8K | |
| check_ups_alarm.pl | 2025-04-02 19:40 | 8.8K | |
| check_snmp_vmware_cpu | 2025-04-02 19:39 | 8.8K | |
| check_px5XX_new.pl | 2025-04-02 19:40 | 8.8K | |
| check_px5XX.pl | 2025-04-02 19:40 | 8.8K | |
| repairer-0.4.5-1.src..> | 2025-04-02 19:39 | 8.8K | |
| check_prtdiag | 2025-04-02 19:39 | 8.9K | |
| check_schedulered | 2025-04-02 19:38 | 8.9K | |
| check_solaris_cpu_us..> | 2025-04-02 19:39 | 8.9K | |
| check_dnsbl | 2025-04-02 19:38 | 8.9K | |
| check_disk_smb_spaces | 2025-04-02 19:38 | 9.0K | |
| fedora.tar.gz | 2025-04-02 19:39 | 9.0K | |
| check_serviceguard-1..> | 2025-04-02 19:38 | 9.0K | |
| sensatronics.tar | 2025-04-02 19:39 | 9.0K | |
| checkagent | 2025-04-02 19:39 | 9.0K | |
| ironport.zip | 2025-04-02 19:39 | 9.0K | |
| check_cpu_snmp.tar.gz | 2025-04-02 19:38 | 9.0K | |
| check_fortigate_vpn.pl | 2025-04-02 19:39 | 9.1K | |
| check_ospf.tar.gz | 2025-04-02 19:38 | 9.1K | |
| check_sbc_stats.v1-5.py | 2025-04-02 19:39 | 9.1K | |
| check_nagios_latency..> | 2025-04-02 19:39 | 9.1K | |
| check_solaris_procs_..> | 2025-04-02 19:39 | 9.1K | |
| check_snmp_cisco | 2025-04-02 19:40 | 9.1K | |
| check_ram.txt | 2025-04-02 19:38 | 9.2K | |
| check_asterisk_sip_p..> | 2025-04-02 19:38 | 9.2K | |
| check_cisco_envmon.0..> | 2025-04-02 19:40 | 9.2K | |
| check_aacraid.pl | 2025-04-02 19:39 | 9.3K | |
| check_linksys.pl | 2025-04-02 19:39 | 9.3K | |
| check_remote_disk_sp..> | 2025-04-02 19:38 | 9.3K | |
| check_iftraffic.pl | 2025-04-02 19:38 | 9.3K | |
| check_nfs4.0.1.pl | 2025-04-02 19:38 | 9.3K | |
| check_areca.pl | 2025-04-02 19:39 | 9.3K | |
| check_snmp_vmware_netio | 2025-04-02 19:39 | 9.3K | |
| TFTP-1.0.tgz | 2025-04-02 19:38 | 9.3K | |
| check_snmp_IBM_Blade..> | 2025-04-02 19:38 | 9.4K | |
| check_flexlm_perf_da..> | 2025-04-02 19:38 | 9.4K | |
| linkth_check.tar.gz | 2025-04-02 19:39 | 9.4K | |
| ingate.tgz | 2025-04-02 19:39 | 9.4K | |
| nagios-plugin-snmp-a..> | 2025-04-02 19:38 | 9.5K | |
| check_disk_snmp.pl | 2025-04-02 19:38 | 9.5K | |
| check-packeteer-0.1.tgz | 2025-04-02 19:40 | 9.5K | |
| check_cuda V31.zip.zip | 2025-04-02 19:38 | 9.6K | |
| check_smartarray.vbs | 2025-04-02 19:39 | 9.6K | |
| check_ultrabac.vbs.txt | 2025-04-02 19:38 | 9.6K | |
| check_ospfRuns.tar.gz | 2025-04-02 19:38 | 9.6K | |
| check_snmp_overland.pl | 2025-04-02 19:40 | 9.6K | |
| check_snmp_printer | 2025-04-02 19:39 | 9.7K | |
| nagios-reporter.v131.pl | 2025-04-02 19:39 | 9.8K | |
| check_solaris_pca_1_..> | 2025-04-02 19:39 | 9.8K | |
| check_syncrepl.py | 2025-04-02 19:38 | 9.8K | |
| check_ups_pow.pl | 2025-04-02 19:39 | 9.8K | |
| check_promise_chassi..> | 2025-04-02 19:39 | 9.8K | |
| check_lxp-controller..> | 2025-04-02 19:38 | 9.8K | |
| check_suncluster.txt | 2025-04-02 19:39 | 9.8K | |
| check_ipmi.pl | 2025-04-02 19:39 | 9.8K | |
| check_dell_aacraid.w..> | 2025-04-02 19:39 | 9.8K | |
| check_raid_gmirror.pl | 2025-04-02 19:38 | 9.8K | |
| check_multiprocs | 2025-04-02 19:38 | 9.9K | |
| check_topology-1.0.t..> | 2025-04-02 19:39 | 9.9K | |
| check_munin_rrd.pl | 2025-04-02 19:38 | 9.9K | |
| check_nfs4.0.2.pl | 2025-04-02 19:38 | 9.9K | |
| check-packeteer-v0.2..> | 2025-04-02 19:40 | 9.9K | |
| check_snmp_FCports_b..> | 2025-04-02 19:40 | 9.9K | |
| check_file-1.1.tar.gz | 2025-04-02 19:39 | 9.9K | |
| check_bgp.0.4.pl | 2025-04-02 19:38 | 10K | |
| check_tw_cli | 2025-04-02 19:39 | 10K | |
| check_snmp_isl_cisco..> | 2025-04-02 19:40 | 10K | |
| check_mysql-replicat..> | 2025-04-02 19:38 | 10K | |
| check_sap.pl | 2025-04-02 19:38 | 10K | |
| check_asterisk_peers | 2025-04-02 19:38 | 10K | |
| check_snmp_FCports_b..> | 2025-04-02 19:40 | 10K | |
| check_dxml_drvstate_..> | 2025-04-02 19:39 | 10K | |
| check_solaris_smf_1_..> | 2025-04-02 19:39 | 10K | |
| check_weblogic_sessi..> | 2025-04-02 19:39 | 10K | |
| check_lsi_megaraid.txt | 2025-04-02 19:39 | 10K | |
| check_omsa_snmp.pl | 2025-04-02 19:39 | 10K | |
| check_squid | 2025-04-02 19:38 | 10K | |
| win_service_restart.zip | 2025-04-02 19:39 | 10K | |
| check_email_loop_v1...> | 2025-04-02 19:38 | 10K | |
| check_fping.tar.gz | 2025-04-02 19:38 | 10K | |
| check_http_enhanced.pl | 2025-04-02 19:38 | 10K | |
| check_jetstor | 2025-04-02 19:38 | 10K | |
| check_ups_mge.pl | 2025-04-02 19:39 | 10K | |
| check_url_status_1.3 | 2025-04-02 19:38 | 10K | |
| check_dns_secondary.pl | 2025-04-02 19:38 | 11K | |
| hardware.tgz | 2025-04-02 19:39 | 11K | |
| eventhandler_restart..> | 2025-04-02 19:39 | 11K | |
| check_dd.pl | 2025-04-02 19:40 | 11K | |
| APC_PDU-1.1.tgz | 2025-04-02 19:39 | 11K | |
| nagios-statd-3.12.ta..> | 2025-04-02 19:39 | 11K | |
| check_env_stats.py | 2025-04-02 19:40 | 11K | |
| check_iflocal.tar.gz | 2025-04-02 19:39 | 11K | |
| check_multiaddr.pl | 2025-04-02 19:39 | 11K | |
| scan_log.txt | 2025-04-02 19:39 | 11K | |
| check_all4k.pl | 2025-04-02 19:40 | 11K | |
| check_bonding_linux | 2025-04-02 19:39 | 11K | |
| check_all_ips.pl | 2025-04-02 19:39 | 11K | |
| check_summary.pl | 2025-04-02 19:39 | 11K | |
| check_snmp_hpux_load.pl | 2025-04-02 19:38 | 11K | |
| nagios-snmp-communit..> | 2025-04-02 19:38 | 11K | |
| check_dell_omreport...> | 2025-04-02 19:39 | 11K | |
| naglib.py.txt | 2025-04-02 19:38 | 11K | |
| check_email_loop_v1...> | 2025-04-02 19:38 | 11K | |
| check_serviceguard-1..> | 2025-04-02 19:38 | 11K | |
| nagios-1010.zip | 2025-04-02 19:39 | 11K | |
| check_bind.sh | 2025-04-02 19:39 | 11K | |
| check_mq-2.1.tgz | 2025-04-02 19:38 | 11K | |
| scan_daily_log.txt | 2025-04-02 19:39 | 12K | |
| check_by_telnet.tar.gz | 2025-04-02 19:39 | 12K | |
| check_nagios_latency..> | 2025-04-02 19:39 | 12K | |
| check_nagios_latency..> | 2025-04-02 19:39 | 12K | |
| check_infratec_rms.pl | 2025-04-02 19:39 | 12K | |
| loadconfig.pl | 2025-04-02 19:39 | 12K | |
| check_x224 | 2025-04-02 19:39 | 12K | |
| check_prtdiag.txt | 2025-04-02 19:39 | 12K | |
| nagios2cacti_pipe.odg | 2025-04-02 19:39 | 12K | |
| check_cpu.pl | 2025-04-02 19:39 | 12K | |
| check_solaris_nics_1..> | 2025-04-02 19:39 | 12K | |
| nagpy-0.2.1.tar.bz2 | 2025-04-02 19:39 | 12K | |
| Nagios-WebTransact-0..> | 2025-04-02 19:38 | 12K | |
| check_cciss-1.9 | 2025-04-02 19:39 | 12K | |
| check_serviceguard-1..> | 2025-04-02 19:38 | 12K | |
| nagios-ping-tool-v03..> | 2025-04-02 19:39 | 12K | |
| check_akcp.pl | 2025-04-02 19:40 | 12K | |
| check_networking.txt | 2025-04-02 19:38 | 12K | |
| check_teamspeak | 2025-04-02 19:38 | 12K | |
| nagios.gif | 2025-04-02 19:39 | 13K | |
| check_nfs_health.sh | 2025-04-02 19:38 | 13K | |
| check_process_cpu.py | 2025-04-02 19:39 | 13K | |
| nagios-check_apaches..> | 2025-04-02 19:38 | 13K | |
| check_emailers.wsf | 2025-04-02 19:39 | 13K | |
| check_icmp-0.8.tar.gz | 2025-04-02 19:38 | 13K | |
| check_disk.pl | 2025-04-02 19:39 | 13K | |
| check_topology-1.0-0..> | 2025-04-02 19:39 | 13K | |
| nagios_xen_plugin.py | 2025-04-02 19:38 | 13K | |
| check_icmp-0.8.1.tar.gz | 2025-04-02 19:38 | 13K | |
| scsc-nagios-checkdax..> | 2025-04-02 19:39 | 13K | |
| esensors.zip | 2025-04-02 19:40 | 13K | |
| check_traffic-0.90b...> | 2025-04-02 19:38 | 13K | |
| check_pcmeasure2.pl | 2025-04-02 19:40 | 13K | |
| snmptraps-0.0.4.tar.gz | 2025-04-02 19:39 | 13K | |
| check_exchange.zip | 2025-04-02 19:39 | 13K | |
| check_cciss-1.10 | 2025-04-02 19:39 | 13K | |
| check_nagios_summary..> | 2025-04-02 19:39 | 13K | |
| check_weblogic_heapf..> | 2025-04-02 19:39 | 13K | |
| check_serviceguard-1..> | 2025-04-02 19:38 | 13K | |
| check_vnc.txt | 2025-04-02 19:38 | 13K | |
| check_ganglia.pl | 2025-04-02 19:38 | 13K | |
| check_serviceguard-1..> | 2025-04-02 19:38 | 13K | |
| check_sap_rfcping | 2025-04-02 19:38 | 13K | |
| nagircbot-0.0.16.tgz | 2025-04-02 19:39 | 13K | |
| check_proliant.py | 2025-04-02 19:39 | 13K | |
| check_apt_snmp.zip | 2025-04-02 19:38 | 13K | |
| check_drbd-0.5.1 | 2025-04-02 19:39 | 13K | |
| check_updatetime-0.0..> | 2025-04-02 19:38 | 14K | |
| naupy-0.02.tar | 2025-04-02 19:38 | 14K | |
| hwinfo.php | 2025-04-02 19:39 | 14K | |
| check_drbd-0.5.2 | 2025-04-02 19:39 | 14K | |
| check_ironport | 2025-04-02 19:38 | 14K | |
| nagios2cacti_udp.odg | 2025-04-02 19:39 | 14K | |
| check_ilom.pl | 2025-04-02 19:39 | 14K | |
| cmddist-0.0.2.tar.gz | 2025-04-02 19:39 | 14K | |
| check_icmp-0.5.tar.gz | 2025-04-02 19:38 | 14K | |
| check_serviceguard-1..> | 2025-04-02 19:39 | 14K | |
| check_sys-1.4.tgz | 2025-04-02 19:39 | 14K | |
| check_drbd | 2025-04-02 19:39 | 14K | |
| check_serviceguard-1..> | 2025-04-02 19:39 | 14K | |
| check_cciss-1.11 | 2025-04-02 19:39 | 14K | |
| check_files_ucd | 2025-04-02 19:38 | 14K | |
| check_cciss-1.12 | 2025-04-02 19:39 | 14K | |
| nagios-ping-tool-v00..> | 2025-04-02 19:39 | 14K | |
| statusXML.php | 2025-04-02 19:39 | 14K | |
| check-smstools.tar.gz | 2025-04-02 19:39 | 14K | |
| nagios-snmp-plugins-..> | 2025-04-02 19:38 | 14K | |
| nagios-push-ssh-all...> | 2025-04-02 19:39 | 14K | |
| slurpd_status.txt | 2025-04-02 19:38 | 15K | |
| check_sun_vm.pl | 2025-04-02 19:39 | 15K | |
| check_linux_vol.pl | 2025-04-02 19:38 | 15K | |
| check_cisco_ips.pl.txt | 2025-04-02 19:38 | 15K | |
| check_netapp2 | 2025-04-02 19:39 | 15K | |
| nagios-2.3-snmpcommu..> | 2025-04-02 19:38 | 15K | |
| check_mountpoints.sh | 2025-04-02 19:40 | 15K | |
| check_jboss.pl | 2025-04-02 19:38 | 15K | |
| LICENSE.txt | 2025-04-02 19:38 | 15K | |
| check_snmp_dell_powe..> | 2025-04-02 19:39 | 15K | |
| checkFileAge.java | 2025-04-02 19:39 | 15K | |
| check_processes_ucd | 2025-04-02 19:38 | 15K | |
| BASPSTAT.txt | 2025-04-02 19:39 | 15K | |
| check_svn.txt | 2025-04-02 19:38 | 15K | |
| contivity-img.zip | 2025-04-02 19:39 | 15K | |
| check_3ware_raid | 2025-04-02 19:39 | 15K | |
| check_load_ucd | 2025-04-02 19:38 | 15K | |
| check_disks_ucd | 2025-04-02 19:38 | 15K | |
| check_3ware_raid_1_1 | 2025-04-02 19:39 | 15K | |
| check_cciss-1.13 | 2025-04-02 19:39 | 15K | |
| nwsc.tgz | 2025-04-02 19:39 | 15K | |
| check_hpux.tar.gz | 2025-04-02 19:39 | 15K | |
| ncap-0.4.x-documenta..> | 2025-04-02 19:39 | 15K | |
| check_cciss-1.14 | 2025-04-02 19:39 | 15K | |
| check_extcmd_ucd | 2025-04-02 19:38 | 15K | |
| VMIO.tar.gz | 2025-04-02 19:39 | 16K | |
| check_ifoperstatus.0..> | 2025-04-02 19:38 | 16K | |
| get_snmp.php | 2025-04-02 19:38 | 16K | |
| check_om_storage.pl | 2025-04-02 19:39 | 16K | |
| check_emc_clariion.pl | 2025-04-02 19:40 | 16K | |
| check_vmware3.pl | 2025-04-02 19:39 | 16K | |
| NWNAGMON.NLM | 2025-04-02 19:39 | 16K | |
| check_ilom-1.3.pl | 2025-04-02 19:39 | 16K | |
| check_osx_services-1..> | 2025-04-02 19:39 | 16K | |
| check_swapspace_ucd | 2025-04-02 19:38 | 16K | |
| check_email_loop_v1...> | 2025-04-02 19:38 | 16K | |
| bb2ns-v1.1.tar.gz | 2025-04-02 19:39 | 17K | |
| check_snmp_supermicr..> | 2025-04-02 19:39 | 17K | |
| check_cisco_voice.ta..> | 2025-04-02 19:38 | 17K | |
| checkFileAgeExec.java | 2025-04-02 19:39 | 17K | |
| check_cciss-1.15 | 2025-04-02 19:39 | 17K | |
| nagios-snmp-plugins-..> | 2025-04-02 19:38 | 18K | |
| nagios-snmp-plugins-..> | 2025-04-02 19:38 | 18K | |
| nagios-snmp-plugins-..> | 2025-04-02 19:38 | 18K | |
| check_hwinfo.pl | 2025-04-02 19:39 | 18K | |
| nagios-snmp-plugins-..> | 2025-04-02 19:38 | 18K | |
| nagios-snmp-plugins-..> | 2025-04-02 19:38 | 18K | |
| nagios-snmp-plugins-..> | 2025-04-02 19:38 | 18K | |
| check_zfs.pl | 2025-04-02 19:39 | 18K | |
| check_zypper | 2025-04-02 19:38 | 18K | |
| BASPCFG.txt | 2025-04-02 19:39 | 18K | |
| nagios-2.0rc2-snmpco..> | 2025-04-02 19:38 | 18K | |
| check_temperature.sh | 2025-04-02 19:40 | 18K | |
| gentoo.zip | 2025-04-02 19:39 | 18K | |
| nagios-2.4-ipaddress..> | 2025-04-02 19:38 | 18K | |
| check_writable-2.0.1..> | 2025-04-02 19:38 | 18K | |
| Plugin.pm | 2025-04-02 19:39 | 18K | |
| radauth.c | 2025-04-02 19:38 | 18K | |
| check_rrd.pl | 2025-04-02 19:39 | 18K | |
| snmp_disk | 2025-04-02 19:38 | 19K | |
| Nagios_CCMS.txt | 2025-04-02 19:38 | 19K | |
| check_bandwidth-3.0...> | 2025-04-02 19:38 | 19K | |
| scsc-nagios-plugins-..> | 2025-04-02 19:38 | 19K | |
| as400NagiosPlugin-01..> | 2025-04-02 19:39 | 19K | |
| nsclient_updateV2.vbs | 2025-04-02 19:39 | 19K | |
| nagserv-0.0.26.tgz | 2025-04-02 19:39 | 19K | |
| as400NagiosPlugin-01..> | 2025-04-02 19:39 | 19K | |
| check_email_loop_v1...> | 2025-04-02 19:38 | 19K | |
| check_email_loop_v1...> | 2025-04-02 19:38 | 19K | |
| check_ica_servers.pl | 2025-04-02 19:39 | 19K | |
| check_email_loop_v1...> | 2025-04-02 19:38 | 20K | |
| as400NagiosPlugin-01..> | 2025-04-02 19:39 | 20K | |
| check_hr-3.9.tar.gz | 2025-04-02 19:39 | 20K | |
| check_clamav_time | 2025-04-02 19:38 | 20K | |
| check_writable-2.0.1..> | 2025-04-02 19:38 | 20K | |
| check_afs_rpc-1.0.2-..> | 2025-04-02 19:40 | 20K | |
| Eventlog.exe | 2025-04-02 19:39 | 20K | |
| check_http_nrpe.exe | 2025-04-02 19:39 | 20K | |
| nagiosws.wsdl.xml | 2025-04-02 19:38 | 20K | |
| check_tftp.sh | 2025-04-02 19:38 | 21K | |
| check_net-snmp_hpux_..> | 2025-04-02 19:38 | 21K | |
| nagios-1.2-ipadresse..> | 2025-04-02 19:38 | 21K | |
| check_prtdiag.conf | 2025-04-02 19:39 | 21K | |
| check_serviceguard-1..> | 2025-04-02 19:39 | 21K | |
| check_snmp_hpux_stor..> | 2025-04-02 19:38 | 21K | |
| check_serverview_py.zip | 2025-04-02 19:39 | 21K | |
| check_afs_rpc-1.0.2...> | 2025-04-02 19:40 | 21K | |
| check_bandwidth-1.1...> | 2025-04-02 19:38 | 21K | |
| check_netapp3.pl | 2025-04-02 19:39 | 22K | |
| check_snmp_switch_sa..> | 2025-04-02 19:40 | 22K | |
| check_lm_sensors-3.1..> | 2025-04-02 19:39 | 22K | |
| cisco_ips.pl | 2025-04-02 19:39 | 22K | |
| check_fortigate_cpu | 2025-04-02 19:39 | 22K | |
| as400NagiosPlugin-01..> | 2025-04-02 19:39 | 23K | |
| check_writable-2.0.1..> | 2025-04-02 19:38 | 23K | |
| nagios-2.0rc1-ipaddr..> | 2025-04-02 19:38 | 23K | |
| check_connections-2...> | 2025-04-02 19:39 | 23K | |
| nagios-2.0rc2-ipaddr..> | 2025-04-02 19:38 | 23K | |
| check_mssql | 2025-04-02 19:39 | 23K | |
| check_megaraid.pl | 2025-04-02 19:39 | 23K | |
| check_serviceguard-1..> | 2025-04-02 19:39 | 24K | |
| check_linux_bonding-..> | 2025-04-02 19:39 | 24K | |
| check_lm_sensors-3.1..> | 2025-04-02 19:39 | 24K | |
| smsfinder.pl | 2025-04-02 19:39 | 24K | |
| check_vmware.jar | 2025-04-02 19:39 | 24K | |
| check_serviceguard-1..> | 2025-04-02 19:39 | 25K | |
| check_afs_rpc-1.0.2-..> | 2025-04-02 19:40 | 25K | |
| check_logserver | 2025-04-02 19:39 | 25K | |
| checkNut.tgz | 2025-04-02 19:39 | 25K | |
| nagios-plugins-check..> | 2025-04-02 19:38 | 25K | |
| check_snmp_acs_pm.pl | 2025-04-02 19:40 | 26K | |
| check_iberr.pl | 2025-04-02 19:39 | 26K | |
| check_snmp_acs_pm_ce..> | 2025-04-02 19:38 | 27K | |
| check_linux_procstat.pl | 2025-04-02 19:39 | 27K | |
| check_lm_sensors-3.1..> | 2025-04-02 19:39 | 28K | |
| check_gentoo_portage | 2025-04-02 19:39 | 28K | |
| check_snmp_baytech_p..> | 2025-04-02 19:40 | 28K | |
| check_printers.diff | 2025-04-02 19:38 | 29K | |
| Nagios-Object-0.05.t..> | 2025-04-02 19:38 | 29K | |
| nagios-wsc-v1.0_Rel.zip | 2025-04-02 19:39 | 30K | |
| ent-plug-mysql-1.0.1..> | 2025-04-02 19:39 | 30K | |
| check_linux_bonding-..> | 2025-04-02 19:39 | 30K | |
| loadlogs.pl | 2025-04-02 19:39 | 30K | |
| check_connections-2...> | 2025-04-02 19:39 | 31K | |
| ent-plug-mysql-1.0.1..> | 2025-04-02 19:39 | 31K | |
| whiteLine.zip | 2025-04-02 19:39 | 31K | |
| ncap-plugin-0.4.3-1...> | 2025-04-02 19:39 | 32K | |
| check_cisco_ips_int...> | 2025-04-02 19:38 | 33K | |
| check_mscs_hpma | 2025-04-02 19:39 | 33K | |
| check_nwstat.tgz | 2025-04-02 19:39 | 33K | |
| nagdash-0.1.tar.gz | 2025-04-02 19:38 | 34K | |
| check_connections-2...> | 2025-04-02 19:39 | 34K | |
| check_jmx.tgz | 2025-04-02 19:38 | 34K | |
| check_infratec_rms.pdf | 2025-04-02 19:39 | 35K | |
| COPYING | 2025-04-02 19:39 | 35K | |
| check_netstat.pl | 2025-04-02 19:40 | 35K | |
| check_procs_multi-1...> | 2025-04-02 19:38 | 36K | |
| ncmd.gz | 2025-04-02 19:39 | 36K | |
| check_dir-3.0.0.tar.gz | 2025-04-02 19:39 | 37K | |
| check_ilo2_health.pl | 2025-04-02 19:39 | 37K | |
| check_tcptraffic-2.2..> | 2025-04-02 19:38 | 38K | |
| nagiosicons-garethr-..> | 2025-04-02 19:39 | 38K | |
| check_sasraid_megara..> | 2025-04-02 19:39 | 38K | |
| scsc-nagios-plugins-..> | 2025-04-02 19:38 | 39K | |
| nw2snmptt.tgz | 2025-04-02 19:39 | 39K | |
| check_cpqdisks.tar.gz | 2025-04-02 19:39 | 39K | |
| nagios-plugins-check..> | 2025-04-02 19:38 | 39K | |
| check_gtp_v2.pl | 2025-04-02 19:40 | 39K | |
| elog.exe | 2025-04-02 19:39 | 40K | |
| naghostgroups.tar | 2025-04-02 19:38 | 40K | |
| ent-plug-mssql-1.0.1..> | 2025-04-02 19:39 | 41K | |
| SNMP-Util-1.9.tar.gz | 2025-04-02 19:39 | 41K | |
| ent-plug-mssql-1.0.1..> | 2025-04-02 19:39 | 42K | |
| Nagios-Plugin-0.33.t..> | 2025-04-02 19:39 | 42K | |
| radauth-1.00.tar.gz | 2025-04-02 19:38 | 42K | |
| check_snmp_temperatu..> | 2025-04-02 19:40 | 42K | |
| nagios2cacti.0.3.0.t..> | 2025-04-02 19:39 | 42K | |
| imagepak-satrapa.zip | 2025-04-02 19:39 | 42K | |
| ItassitantSendToNagi..> | 2025-04-02 19:39 | 43K | |
| check_diskio-3.2.8.t..> | 2025-04-02 19:39 | 43K | |
| Nsca.pm | 2025-04-02 19:39 | 44K | |
| check_tcp.exe | 2025-04-02 19:39 | 44K | |
| ncap-0.4.3-1.fedora1..> | 2025-04-02 19:39 | 44K | |
| check_sasraid_megara..> | 2025-04-02 19:39 | 45K | |
| check_radius_adv_200..> | 2025-04-02 19:40 | 45K | |
| check_radius_ih-1.1.tgz | 2025-04-02 19:38 | 45K | |
| remus.zip | 2025-04-02 19:39 | 46K | |
| H150E-MIB.txt | 2025-04-02 19:39 | 50K | |
| avail.c.patch_csv-ou..> | 2025-04-02 19:39 | 51K | |
| patch-nagios-2.5-v2-..> | 2025-04-02 19:38 | 51K | |
| jeanluc.zip | 2025-04-02 19:39 | 52K | |
| LICENSE | 2025-04-02 19:40 | 53K | |
| check_printer.tar.gz | 2025-04-02 19:38 | 58K | |
| grayscale.zip | 2025-04-02 19:39 | 60K | |
| werschler.zip | 2025-04-02 19:39 | 60K | |
| Report.pm | 2025-04-02 19:39 | 62K | |
| check_chkrootkit-1.0..> | 2025-04-02 19:39 | 64K | |
| check_snmp-1.1.tar.bz2 | 2025-04-02 19:38 | 66K | |
| check_snmp-1.2.tar.bz2 | 2025-04-02 19:38 | 66K | |
| nagiosEventLogPlugin..> | 2025-04-02 19:39 | 66K | |
| check_snmp-1.4.tar.bz2 | 2025-04-02 19:38 | 67K | |
| check_snmp-1.3.tar.bz2 | 2025-04-02 19:38 | 67K | |
| check_bastille-1.0.4..> | 2025-04-02 19:39 | 67K | |
| run_background_check..> | 2025-04-02 19:39 | 69K | |
| Nagios-Report-0.003...> | 2025-04-02 19:39 | 69K | |
| tac-with-colors.tar | 2025-04-02 19:38 | 70K | |
| nagios_mdaemon_stats..> | 2025-04-02 19:38 | 70K | |
| network-symbols.zip | 2025-04-02 19:39 | 72K | |
| birdseye.zip | 2025-04-02 19:39 | 72K | |
| nsjs.zip | 2025-04-02 19:39 | 73K | |
| nagios_mdaemon_check..> | 2025-04-02 19:38 | 75K | |
| check_proc.exe | 2025-04-02 19:39 | 76K | |
| check_email_delivery..> | 2025-04-02 19:38 | 76K | |
| Nagstatus.gadget | 2025-04-02 19:38 | 77K | |
| linuxcpuio_2xeon_2sc..> | 2025-04-02 19:39 | 77K | |
| didier.zip | 2025-04-02 19:39 | 77K | |
| check_snmp_netint_21.pl | 2025-04-02 19:38 | 81K | |
| check_snmp_raid.pl | 2025-04-02 19:39 | 82K | |
| check_netapp-1.9.1.t..> | 2025-04-02 19:40 | 85K | |
| nagios3_presentation..> | 2025-04-02 19:39 | 87K | |
| check_esx2.2.tar | 2025-04-02 19:39 | 90K | |
| check_esx2.3.tar | 2025-04-02 19:39 | 90K | |
| check_esx2.4.tar | 2025-04-02 19:39 | 90K | |
| sensatronics-mibs.zip | 2025-04-02 19:40 | 91K | |
| mntos-1.0.tar.gz | 2025-04-02 19:39 | 94K | |
| check_snmp_environme..> | 2025-04-02 19:39 | 95K | |
| ncom-submit.tar.gz | 2025-04-02 19:39 | 97K | |
| check_be.exe | 2025-04-02 19:38 | 98K | |
| mntos-1.0.4.tar.gz | 2025-04-02 19:39 | 98K | |
| check_snmp_netint.pl | 2025-04-02 19:38 | 100K | |
| imagepak-bernhard.zip | 2025-04-02 19:39 | 113K | |
| GatorLUG-1.pdf | 2025-04-02 19:39 | 115K | |
| nagios-wsc_v1_3_4.zip | 2025-04-02 19:39 | 117K | |
| temptrax.tar.gz | 2025-04-02 19:40 | 119K | |
| nscafe_1.0.tar | 2025-04-02 19:39 | 120K | |
| statusmap.c | 2025-04-02 19:38 | 121K | |
| check_netint.pl | 2025-04-02 19:38 | 126K | |
| snmppd-0.5.2.tar.gz | 2025-04-02 19:39 | 126K | |
| check_email_delivery..> | 2025-04-02 19:38 | 128K | |
| ncap-0.4.3.tar.gz | 2025-04-02 19:39 | 128K | |
| send_nsca_win32_bin.zip | 2025-04-02 19:39 | 130K | |
| ncap-0.4.3-1.src.rpm | 2025-04-02 19:39 | 132K | |
| nagiosws-0.3.tar.gz | 2025-04-02 19:38 | 133K | |
| Plugins_oracle.rar | 2025-04-02 19:39 | 134K | |
| check_tping-0.1.1.ta..> | 2025-04-02 19:38 | 137K | |
| NagiosPluginsNT-0.4...> | 2025-04-02 19:39 | 142K | |
| tnt_plugins_1.1.2-x8..> | 2025-04-02 19:39 | 158K | |
| pdatac-0.1.tgz | 2025-04-02 19:39 | 158K | |
| check_cmc-tc_temp-1...> | 2025-04-02 19:40 | 158K | |
| Greg_Vickers.ppt | 2025-04-02 19:39 | 159K | |
| check_snmp_plugins.t..> | 2025-04-02 19:38 | 161K | |
| check_cisco_voice.pdf | 2025-04-02 19:38 | 165K | |
| send_nsca_win32_src.zip | 2025-04-02 19:39 | 181K | |
| base.zip | 2025-04-02 19:39 | 181K | |
| handle_SCOM_mail-REA..> | 2025-04-02 19:39 | 194K | |
| Nagios-wsc-v1_3_1.pdf | 2025-04-02 19:39 | 195K | |
| check_interface_tabl..> | 2025-04-02 19:39 | 200K | |
| check_schedulered.exe | 2025-04-02 19:38 | 201K | |
| OpsMgr_Nagios_SMTP-v..> | 2025-04-02 19:39 | 209K | |
| OpsMgr_Nagios_SMTP-v..> | 2025-04-02 19:39 | 212K | |
| nrpe_nt_patch.zip | 2025-04-02 19:39 | 219K | |
| mq-utils.jar | 2025-04-02 19:38 | 220K | |
| nagios-plugins-cpq.1..> | 2025-04-02 19:39 | 224K | |
| nagios-hp-agents.2.0..> | 2025-04-02 19:39 | 226K | |
| nagios-hp-agents.2.1..> | 2025-04-02 19:39 | 226K | |
| nagios-hp-agents.2.2..> | 2025-04-02 19:39 | 227K | |
| nagios-hp-agents.2.3..> | 2025-04-02 19:39 | 227K | |
| check_hp-2.4.tar.gz | 2025-04-02 19:39 | 227K | |
| nagios-2.0b3_cz-b1.zip | 2025-04-02 19:39 | 232K | |
| check_mssql_nt_v01.zip | 2025-04-02 19:39 | 240K | |
| wincheck_counter_1.1..> | 2025-04-02 19:39 | 258K | |
| check_autoit-1.0.zip | 2025-04-02 19:39 | 278K | |
| cook.zip | 2025-04-02 19:39 | 282K | |
| SNMP-Trap-Handling-H..> | 2025-04-02 19:38 | 294K | |
| nagios-plugins-cpq-2..> | 2025-04-02 19:39 | 300K | |
| check_esx3.0alpha.tar | 2025-04-02 19:39 | 320K | |
| vendor-logos.zip | 2025-04-02 19:39 | 325K | |
| MIBs.zip | 2025-04-02 19:39 | 343K | |
| check_hp-3.3.tar.gz | 2025-04-02 19:39 | 371K | |
| check_win_eventlog-0..> | 2025-04-02 19:39 | 382K | |
| nsclient_-_no_pdh.zip | 2025-04-02 19:39 | 537K | |
| ccms_plugin.pdf | 2025-04-02 19:38 | 545K | |
| nagios_adding_object..> | 2025-04-02 19:39 | 569K | |
| check_win_process.exe | 2025-04-02 19:39 | 608K | |
| afaapps-2.6-0.tar.tar | 2025-04-02 19:39 | 626K | |
| ccms.pdf | 2025-04-02 19:38 | 642K | |
| afa-linux-app-A01.ta..> | 2025-04-02 19:39 | 765K | |
| nagwen-0.1.tar.gz | 2025-04-02 19:39 | 778K | |
| HowTo_Check_Windows_..> | 2025-04-02 19:39 | 817K | |
| powernet368_mib.txt | 2025-04-02 19:38 | 828K | |
| 30-angelini.pdf | 2025-04-02 19:38 | 879K | |
| nrpe_nt_plugins.zip | 2025-04-02 19:39 | 939K | |
| NetAppPlugins.pdf | 2025-04-02 19:39 | 1.0M | |
check_allnet.pl - Checks the allnet environmental devies for NAGIOS.
check_allnet.pl -h
check_allnet.pl --man
check_allnet.pl -H <host> -u <probe> -w <warning> -c <critical> [-U username] [-P password] [-p web_port] [-L /to_xml_data] [-A my_agent/1.0 ] [-T timeout] [--bool=value_of_false] [--legend=rz6_temp]
check_allnet.pl recieves the XML data from the allnet devices. It can check thresholds and boolean states of the connected probes.
1. start <= end
The startvalue have to be less than the endvalue
2. start and ':' is not required if start=0>
If you set a threshold of '12' it's the same like '0:12'
3. if range is of format ``start:'' and end is not specified, assume end is infinity
4. to specify negative infinity, use '~' (tilde)
For example: ~10:~2 the threshold is from -10 to -2.
5. alert is raised if metric is outside start and end range (inclusive of endpoints)
6. if range starts with ``@'', then alert if inside this range (inclusive of endpoints)
Plugin is under development, beta status:
$Id: check_allnet.pl 835 2005-04-20 08:53:05Z mhein $
NETWAYS GmbH, 2005, http://www.netways.de.
Written by Marius Hein <mhein@netways.de>.
Please report bugs through the contact of Nagios Exchange, http://www.nagiosexchange.org.